CAS 65924-80-3

1-[(4-phenyl-5-thioxo-4,5-dihydro-1H-1,2,4-triazol-3-yl)methyl]piperidinium

Description:

1-[(4-phenyl-5-thioxo-4,5-dihydro-1H-1,2,4-triazol-3-yl)methyl]piperidinium, with CAS number 65924-80-3, is a chemical compound characterized by its unique structural features, which include a piperidinium moiety and a triazole ring. The presence of the thioxo group contributes to its potential reactivity and biological activity. This compound is typically studied for its pharmacological properties, particularly in the context of medicinal chemistry, where it may exhibit antimicrobial or antifungal activities. Its molecular structure allows for various interactions with biological targets, making it a subject of interest in drug development. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. Understanding its characteristics is crucial for exploring its applications in pharmaceuticals and other fields. Further research may reveal additional properties and potential uses in various scientific domains.

Formula: C₁₄H₁₉N₄S

InChI: InChI=1/C14H18N4S/c19-14-16-15-13(11-17-9-5-2-6-10-17)18(14)12-7-3-1-4-8-12/h1,3-4,7-8H,2,5-6,9-11H2,(H,16,19)/p+1

4-Phenyl-5-(piperidin-1-ylmethyl)-4H-1,2,4-triazole-3-thiol

CAS: 65924-80-3

Versatile small molecule scaffold

Formula: C₁₄H₁₈N₄S

Purity: Min. 95%

Molecular weight: 274.39 g/mol

Ref: 3D-QCA92480