CAS 65926-00-3
:(4S,5R)-4-benzyloxy-6-(hydroxymethyl)tetrahydropyran-2,3,5-triol
Description:
The chemical substance known as (4S,5R)-4-benzyloxy-6-(hydroxymethyl)tetrahydropyran-2,3,5-triol, with the CAS number 65926-00-3, is a carbohydrate derivative characterized by its tetrahydropyran ring structure. This compound features multiple hydroxyl groups, which contribute to its hydrophilicity and potential reactivity in various chemical reactions. The presence of a benzyloxy group enhances its stability and solubility in organic solvents, making it useful in synthetic organic chemistry. The specific stereochemistry indicated by the (4S,5R) configuration suggests that it has distinct spatial arrangements that can influence its biological activity and interactions with other molecules. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in the development of glycosides or as intermediates in the synthesis of more complex molecules. Overall, this substance exemplifies the intricate relationship between molecular structure and chemical properties, which is crucial in the field of organic chemistry.
Formula:C13H18O6
InChI:InChI=1/C13H18O6/c14-6-9-10(15)12(11(16)13(17)19-9)18-7-8-4-2-1-3-5-8/h1-5,9-17H,6-7H2/t9?,10-,11?,12+,13?/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-O-Benzyl-D-mannose
CAS:3-O-Benzyl-D-mannose is a glycoside that is synthesized by the reaction of dibutyltin oxide with an anomeric or other glycosidic sugar. The reaction proceeds via a nucleophilic addition of the tin triflate to a glycosyl group followed by an electrophilic alkylation of the resulting alcohol. 3-O-Benzyl-D-mannose can be synthesized from the commercially available compound, D-mannose, and dibutyltin oxide. It has been shown to inhibit axial growth in Escherichia coli cells.Formula:C13H18O6Purity:Min. 95%Molecular weight:270.28 g/mol
