CAS 65929-03-5
:N-Formyl-L-methionyl-L-leucyl-L-phenylalanine methyl ester
Description:
N-Formyl-L-methionyl-L-leucyl-L-phenylalanine methyl ester, with the CAS number 65929-03-5, is a synthetic peptide that consists of three amino acids: methionine, leucine, and phenylalanine, with a formyl group attached to the methionine and a methyl ester at the carboxyl terminal. This compound is characterized by its peptide bond structure, which contributes to its biological activity and potential applications in pharmaceuticals and biochemistry. The presence of the formyl group can influence the compound's reactivity and interaction with biological systems, while the methyl ester can enhance its lipophilicity, potentially affecting its absorption and distribution in biological environments. Peptides like this one are often studied for their roles in signaling pathways, immune responses, and as potential therapeutic agents. Additionally, the specific arrangement of amino acids can impart unique properties, making it a subject of interest in peptide synthesis and drug design.
Formula:C22H33N3O5S
InChI:InChI=1S/C22H33N3O5S/c1-15(2)12-18(24-20(27)17(23-14-26)10-11-31-4)21(28)25-19(22(29)30-3)13-16-8-6-5-7-9-16/h5-9,14-15,17-19H,10-13H2,1-4H3,(H,23,26)(H,24,27)(H,25,28)/t17-,18-,19-/m0/s1
InChI key:InChIKey=FTDSTRQDCPIBEG-FHWLQOOXSA-N
SMILES:[C@@H](CC1=CC=CC=C1)(NC([C@@H](NC([C@H](CCSC)NC=O)=O)CC(C)C)=O)C(OC)=O
Synonyms:- <span class="text-smallcaps">L</smallcap>-Phenylalanine, N-[N-(N-formyl-<smallcap>L</smallcap>-methionyl)-<smallcap>L</span>-leucyl]-, methyl ester
- <span class="text-smallcaps">L</smallcap>-Phenylalanine, N-formyl-<smallcap>L</smallcap>-methionyl-<smallcap>L</span>-leucyl-, methyl ester
- For-Met-Leu-Phe-OMe
- N-Formyl-<span class="text-smallcaps">L</smallcap>-methionyl-<smallcap>L</smallcap>-leucyl-<smallcap>L</span>-phenylalanine methyl ester
- methyl N-formyl-L-methionyl-L-leucyl-L-phenylalaninate
- methyl N-formylmethionylleucylphenylalaninate
- N-Formyl-L-methionyl-L-leucyl-L-phenylalanine methyl ester
- L-Phenylalanine, N-formyl-L-methionyl-L-leucyl-, methyl ester
- L-Phenylalanine, N-[N-(N-formyl-L-methionyl)-L-leucyl]-, methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
For-Met-Leu-Phe-OMe
CAS:For-Met-Leu-Phe-OMe is a drug that has been shown to have anti-inflammatory properties in human cells. For-Met-Leu-Phe-OMe inhibits the production of inflammatory molecules, such as gamma-aminobutyric acid, and it also blocks the binding of leukotrienes to their receptors. These effects are due to its conformational properties, which allow it to bind to the receptor site and inhibit the binding of other molecules. For-Met-Leu-Phe-OMe has been shown to enhance the release of nucleotide levels and intracellular calcium concentration in vitro. It also binds to receptors on cells, which may be due to its biochemical properties or its analogues with other drugs.Formula:C22H33N3O5SPurity:Min. 95%Molecular weight:451.58 g/mol


