CymitQuimica logo

CAS 65934-61-4

:

3,3'-[(propylimino)diethane-2,1-diyl]diphenol

Description:
3,3'-[(Propylimino)diethane-2,1-diyl]diphenol, with the CAS number 65934-61-4, is an organic compound characterized by its structure, which includes two phenolic groups connected by a propylimino bridge. This compound typically exhibits properties associated with phenolic compounds, such as the ability to form hydrogen bonds and act as an antioxidant. It may also display solubility in organic solvents, depending on the specific substituents and their interactions. The presence of the propylimino group suggests potential applications in coordination chemistry or as a ligand in metal complexation. Additionally, the compound may have implications in materials science, particularly in the development of polymers or resins due to its phenolic nature. Its reactivity can be influenced by the functional groups present, making it a candidate for various chemical reactions, including condensation and polymerization. Overall, 3,3'-[(propylimino)diethane-2,1-diyl]diphenol is a versatile compound with potential applications in multiple fields of chemistry.
Formula:C19H25NO2
InChI:InChI=1/C19H25NO2/c1-2-11-20(12-9-16-5-3-7-18(21)14-16)13-10-17-6-4-8-19(22)15-17/h3-8,14-15,21-22H,2,9-13H2,1H3
Synonyms:
  • phenol, 3,3'-[(propylimino)di-2,1-ethanediyl]bis-
  • 3,3'-[(Propylimino)diethane-2,1-diyl]diphenol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • RU 24926

    CAS:
    RU 24926 is a di-(phenethyl)-amine derivative that used as a dopamine-D2 receptor agonist.
    Formula:C19H25NO2
    Color and Shape:Solid
    Molecular weight:299.41