CAS 65934-74-9
:5-Amino-2-methylbenzotrifluoride
Description:
5-Amino-2-methylbenzotrifluoride, with the CAS number 65934-74-9, is an organic compound characterized by the presence of an amino group (-NH2) and a trifluoromethyl group (-CF3) attached to a methyl-substituted benzene ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its aromatic properties, which contribute to its stability and reactivity. The trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The amino group can participate in hydrogen bonding, affecting solubility and reactivity in different solvents. Additionally, the compound may exhibit moderate toxicity, necessitating careful handling and appropriate safety measures during use. Overall, 5-Amino-2-methylbenzotrifluoride is a versatile compound with significant implications in synthetic organic chemistry.
Formula:C6H10F4O
InChI:InChI=1/C6H10F4O/c1-5(2,3)11-6(9,10)4(7)8/h4H,1-3H3
SMILES:CC(C)(C)OC(C(F)F)(F)F
Synonyms:- 4-Methyl-3-(trifluoromethyl)aniline
- 3-Trifluoromethyl-p-toluidine
- 3-(Trifluoromethyl)-4-methylaniline
- 4-Methyl-5-Trifluoromethylaniline
- Tert-Butyl 1,1,2,2-Tetrafluoroethyl Ether
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Methyl-3-(trifluoromethyl)aniline
CAS:Formula:C8H8F3NPurity:98%Color and Shape:LiquidMolecular weight:175.15105-Amino-2-methylbenzotrifluoride
CAS:5-Amino-2-methylbenzotrifluorideFormula:C8H8F3NPurity:98%Color and Shape: clear. very dark red/brown liquidMolecular weight:175.15g/mol4-Methyl-3-(trifluoromethyl)aniline
CAS:Formula:C8H8F3NPurity:>98.0%(GC)(T)Color and Shape:Colorless to Yellow to Orange clear liquidMolecular weight:175.155-Amino-2-methylbenzotrifluoride
CAS:Controlled Product<p>Applications 5-Amino-2-methylbenzotrifluoride is used to prepare azoles as inhibitors of VEGF receptors 1 and 2 with high intestinal permeability. It can also be used to prepare curcumin analogs conjugated with antiandrogens.<br>References Kiselyov, A., et al.: Bioorg. Med. Chem. Lett., 17, 1369 (2007); Shi, Q., et al.: Bioorg. Med. Chem., 20, 4020 (2012)<br></p>Formula:C8H8F3NColor and Shape:NeatMolecular weight:175.154-Methyl-3-(trifluoromethyl)aniline
CAS:Formula:C8H8F3NPurity:98%Color and Shape:Liquid, ClearMolecular weight:175.154




