CAS 65945-06-4

2-Hydroxychrysene

Description:

2-Hydroxychrysene is an organic compound that belongs to the class of polycyclic aromatic hydrocarbons (PAHs). It is characterized by a chrysene backbone with a hydroxyl (-OH) group positioned at the second carbon atom. This substitution can influence its chemical reactivity and solubility compared to its parent compound, chrysene. The presence of the hydroxyl group enhances its potential for hydrogen bonding, which can affect its interactions in biological systems and environmental contexts. 2-Hydroxychrysene is of interest in various fields, including environmental chemistry and toxicology, due to its potential formation during the combustion of organic materials and its implications for human health. It may exhibit mutagenic and carcinogenic properties, similar to other PAHs, necessitating careful handling and assessment in research and industrial applications. Additionally, its physical properties, such as melting point and solubility, can vary based on the specific conditions and the presence of other substances. Overall, 2-Hydroxychrysene serves as a significant compound for studying the effects of PAHs in the environment and their biological impact.

Formula: C₁₈H₁₂O

InChI: InChI=1/C18H12O/c19-14-7-10-16-13(11-14)6-9-17-15-4-2-1-3-12(15)5-8-18(16)17/h1-11,19H

InChI key: InChIKey=RSBSTIBFPNNSTH-UHFFFAOYSA-N

SMILES: OC=1C=C2C(C3=C(C=4C(C=C3)=CC=CC4)C=C2)=CC1

Synonyms:

• 2-Chrysenol
• Chrysen-2-ol
• 2-Hydroxychrysene

2-Hydroxychrysene

Controlled Product

CAS: 65945-06-4

Formula: C₁₈H₁₂O

Color and Shape: Neat

Molecular weight: 244.29

Ref: TR-H905340

2-Hydroxychrysene-d11

Controlled Product

CAS: 65945-06-4

Formula: C₁₈HD₁₁O

Color and Shape: Neat

Molecular weight: 255.36

Ref: TR-H905342