CAS 65947-37-7
:N-[(6R,8R,8aS)-6-allyloxy-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide
Description:
N-[(6R,8R,8aS)-6-allyloxy-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide, with CAS number 65947-37-7, is a complex organic compound characterized by its unique structural features, including a hexahydropyrano dioxin core and multiple functional groups such as an allyloxy and acetamide moiety. This compound exhibits chirality, indicated by the specific stereochemistry at several carbon centers, which can influence its biological activity and interactions. The presence of a phenyl group suggests potential aromatic characteristics, which may contribute to its stability and reactivity. Additionally, the hydroxyl group can participate in hydrogen bonding, affecting solubility and reactivity in various solvents. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological properties, including anti-inflammatory or anticancer activities. However, detailed studies on its specific biological effects, synthesis methods, and applications would be necessary to fully understand its utility in research or therapeutic contexts.
Formula:C18H23NO6
InChI:InChI=1/C18H23NO6/c1-3-9-22-18-14(19-11(2)20)15(21)16-13(24-18)10-23-17(25-16)12-7-5-4-6-8-12/h3-8,13-18,21H,1,9-10H2,2H3,(H,19,20)/t13?,14?,15-,16-,17?,18-/m1/s1
SMILES:C=CCO[C@H]1C([C@H]([C@H]2C(COC(c3ccccc3)O2)O1)O)N=C(C)O
Synonyms:- Allyl-2-acetamido-4,6-O-benzylidene-2-deoxy-b-D-glucopyranoside
- .beta.-D-Glucopyranoside, 2-propenyl 2-(acetylamino)-2-deoxy-4,6-O-(phenylmethylene)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Allyl 2-(Acetylamino)-2-deoxy-4,6-O-(phenylmethylene)-β-D-glucopyranoside
CAS:Molecular weight:349.38Allyl 2-acetamido-4,6-O-benzylidene-2-deoxy-b-D-glucopyranoside
CAS:Allyl 2-acetamido-4,6-O-benzylidene-2-deoxy-b-D-glucopyranoside is a synthetic compound that belongs to the class of carbohydrates. It is used as a reagent in sugar chemistry and glycosylation reactions. Allyl 2-acetamido-4,6-O-benzylidene-2-deoxy-b-D-glucopyranoside is also used for the modification of polysaccharides and fluorination reactions. This product has been shown to be effective as a substrate for site specific methylation reactions. Allyl 2 acetamido 4,6 O benzylidene 2 deoxy b D glucopyranoside has been tested in vitro against methicillin resistant Staphylococcus aureus (MRSA) with promising results.
Formula:C18H23NO6Purity:Min. 95%Molecular weight:349.39 g/mol

