CAS 65956-64-1
:Cholesterylphosphocholine
Description:
Cholesterylphosphocholine is a phospholipid derivative that combines cholesterol with phosphocholine, making it an important component in biological membranes and lipid bilayers. This compound exhibits amphiphilic properties, possessing both hydrophobic (cholesterol) and hydrophilic (phosphocholine) regions, which allows it to play a crucial role in membrane structure and fluidity. Cholesterylphosphocholine is known for its ability to form lipid vesicles and micelles, facilitating the encapsulation and delivery of hydrophobic drugs. Additionally, it can influence membrane dynamics and protein interactions, contributing to various cellular processes. The substance is often studied in the context of membrane biophysics, drug delivery systems, and the development of biomaterials. Its stability and compatibility with biological systems make it a valuable compound in pharmaceutical and biomedical research. Overall, cholesterylphosphocholine serves as a significant model for understanding lipid interactions and membrane behavior in both health and disease.
Formula:C32H58NO4P
InChI:InChI=1S/C32H58NO4P/c1-23(2)10-9-11-24(3)28-14-15-29-27-13-12-25-22-26(37-38(34,35)36-21-20-33(6,7)8)16-18-31(25,4)30(27)17-19-32(28,29)5/h12,23-24,26-30H,9-11,13-22H2,1-8H3/t24-,26+,27+,28-,29+,30+,31+,32-/m1/s1
InChI key:InChIKey=MWEZHNCHKXEIBJ-RWFZIKKDSA-N
SMILES:C[C@@]12[C@@]3([C@]([C@]4([C@](C)(CC3)[C@@]([C@@H](CCCC(C)C)C)(CC4)[H])[H])(CC=C1C[C@@H](OP(OCC[N+](C)(C)C)(=O)[O-])CC2)[H])[H]
Synonyms:- 2-(Trimethylammonio)ethyl cholest-5-en-3beta-yl hydrogen phosphate
- 2-[[(3S,8S,9S,10R,13R,14S,17R)-17-[(1R)-1,5-dimethylhexyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-hydroxy-phosphoryl]oxyethyl-trimethyl-ammonium
- Cholest-5-en-3-ol (3β)-, 2-(trimethylammonio)ethyl hydrogen phosphate, inner salt
- Cholest-5-en-3-ol (3β)-, 3-[2-(trimethylammonio)ethyl hydrogen phosphate], inner salt
- Cholest-5-en-3-ol (3β)-, ester with N,N,N-trimethyl-2-(phosphonooxy)ethanaminium hydroxide inner salt
- Cholesterylphosphocholine
- Choline, phosphate, cholesteryl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Cholesteryl-phosphorylcholine
CAS:Cholesteryl-phosphorylcholine is a pharmaceutical that inhibits the absorption of cholesterol in the intestines. It is also used as a medicine to lower plasma cholesterol levels and as an anti-inflammatory agent. Cholesteryl-phosphorylcholine binds to bile acids and reduces the reabsorption of cholesterol in the intestines, thereby lowering plasma cholesterol levels. This drug also has anti-inflammatory effects by inhibiting the production of substances that cause inflammation, such as prostaglandins.Purity:Min. 95 Area-%Cholesteryl-phosphorylcholine
CAS:Cholesteryl-phosphorylcholine is a versatile building block that can be used as a reagent or reaction component. It is used in the synthesis of complex compounds, such as pharmaceuticals and agrochemicals. This compound has been shown to have high quality and is useful for research purposes.Formula:C32H58NO4PPurity:Min. 95 Area-%Molecular weight:551.80 g/mol
