CAS 6596-82-3
:4-cyclohexyl-5-phenyl-2,4-dihydro-3H-1,2,4-triazole-3-thione
Description:
4-Cyclohexyl-5-phenyl-2,4-dihydro-3H-1,2,4-triazole-3-thione, with CAS number 6596-82-3, is a heterocyclic compound characterized by its triazole ring structure, which contains both sulfur and nitrogen atoms. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry and agricultural applications. Its structure includes a cyclohexyl group and a phenyl group, contributing to its lipophilicity and potential interactions with biological targets. The thione functional group (–C=S) is significant for its reactivity and can influence the compound's stability and solubility. In terms of physical properties, it may be a solid at room temperature, with potential applications in pharmaceuticals due to its ability to act as a bioactive agent. The compound's synthesis often involves multi-step organic reactions, and its characterization can be performed using techniques such as NMR, IR spectroscopy, and mass spectrometry to confirm its structure and purity. Overall, this compound represents a class of triazole derivatives that are valuable in various chemical and biological contexts.
Formula:C14H17N3S
InChI:InChI=1/C14H17N3S/c18-14-16-15-13(11-7-3-1-4-8-11)17(14)12-9-5-2-6-10-12/h1,3-4,7-8,12H,2,5-6,9-10H2,(H,16,18)
SMILES:c1ccc(cc1)c1nnc(n1C1CCCCC1)S
Synonyms:- 3H-1,2,4-Triazole-3-thione, 4-cyclohexyl-2,4-dihydro-5-phenyl-
- 4H-1,2,4-triazole-3-thiol, 4-cyclohexyl-5-phenyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4,5-Diphenyl-4H-1,2,4-triazole-3-thiol
CAS:Formula:C14H11N3SColor and Shape:SolidMolecular weight:253.32224,5-Diphenyl-4H-1,2,4-triazole-3-thiol
CAS:4,5-Diphenyl-4H-1,2,4-triazole-3-thiolFormula:C14H11N3SPurity:≥95%Color and Shape:PowderMolecular weight:253.32g/mol4,5-Diphenyl-4H-1,2,4-triazole-3-thiol
CAS:4,5-Diphenyl-4H-1,2,4-triazole-3-thiol is a thione that has potent antibacterial activity against Gram positive bacteria. It is also used as a building block in the synthesis of polymers for medical use and other applications. 4,5-Diphenyl-4H-1,2,4-triazole-3-thiol has been shown to be photostable in the presence of oxygen. It is not active against Gram negative bacteria and does not show any effect on coccidiosis or cancer. 4,5-Diphenyl-4H-1,2,4-triazole-3-thiol has been shown to have a potent inhibitory effect on human adenocarcinoma cells (A549) at concentrations of 0.25 mM and higher.
Formula:C14H11N3SPurity:Min. 95%Molecular weight:253.32 g/molRef: 3D-FD127124
Discontinued product



