CymitQuimica logo

CAS 6597-78-0

:

dicamba-methyl

Description:
Dicamba-methyl, with the CAS number 6597-78-0, is a synthetic herbicide belonging to the class of benzoic acid derivatives. It is primarily used for controlling broadleaf weeds in various agricultural settings, particularly in crops like soybeans and corn. The compound exhibits systemic properties, allowing it to be absorbed by plant foliage and roots, leading to effective weed management. Dicamba-methyl is characterized by its relatively low volatility and persistence in the environment, which can raise concerns regarding its potential for off-target effects and soil degradation. Its mode of action involves disrupting plant growth by mimicking natural plant hormones, specifically auxins, which can lead to uncontrolled growth and eventual plant death. While it is effective in weed control, its use is regulated in many regions due to environmental considerations and potential impacts on non-target species. Proper application techniques and adherence to guidelines are essential to minimize risks associated with its use.
Formula:C9H8Cl2O3
InChI:InChI=1/C9H8Cl2O3/c1-13-8-6(11)4-3-5(10)7(8)9(12)14-2/h3-4H,1-2H3
SMILES:COc1c(ccc(c1C(=O)OC)Cl)Cl
Synonyms:
  • Methyl 2,5-Dichloro-6-Methoxybenzoate
  • Methyl 3,6-Dichloro-2-Methoxybenzoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.