CAS 65973-52-6
:Methyl 4,6-dichloronicotinate
Description:
Methyl 4,6-dichloronicotinate is an organic compound belonging to the class of pyridine derivatives, specifically a methyl ester of 4,6-dichloronicotinic acid. It is characterized by the presence of a pyridine ring substituted with two chlorine atoms at the 4 and 6 positions and a methoxy group at the carboxylic acid position. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its potential applications in pharmaceuticals and agrochemicals due to its biological activity. Methyl 4,6-dichloronicotinate may exhibit properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many chlorinated organic compounds. Its chemical structure allows for various reactions, including nucleophilic substitutions and coupling reactions, making it a valuable intermediate in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken due to potential toxicity or environmental impact.
Formula:C7H5Cl2NO2
InChI:InChI=1/C7H5Cl2NO2/c1-12-7(11)4-3-10-6(9)2-5(4)8/h2-3H,1H3
SMILES:COC(=O)c1cnc(cc1Cl)Cl
Synonyms:- 4,6-Dichloronicotinicacidmethylester
- 4,6-Dichloro-nicotinic acid methylester
- Methyl 4,6-Dichloropyridine-3-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 4,6-dichloronicotinate, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C7H5Cl2NO2Purity:95%Molecular weight:206.02Methyl 4,6-Dichloronicotinate
CAS:Formula:C7H5Cl2NO2Purity:97%Color and Shape:SolidMolecular weight:206.0261Methyl 4,6-Dichloronicotinate
CAS:Formula:C7H5Cl2NO2Purity:>95.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:206.024,6-Dichloronicotinic acid methyl ester
CAS:Formula:C7H5Cl2NO2Purity:97%Color and Shape:White to yellow crystalline solidMolecular weight:206.02Methyl 4,6-dichloronicotinate
CAS:Methyl 4,6-dichloronicotinateFormula:C7H5Cl2NO2Purity:98%Color and Shape: faint yellow solidMolecular weight:206.03g/mol




