CAS 65992-17-8

2-[(2-ethoxy-2-oxoethyl)amino]benzoic acid

Description:

2-[(2-Ethoxy-2-oxoethyl)amino]benzoic acid, with the CAS number 65992-17-8, is an organic compound characterized by its structure, which includes a benzoic acid moiety and an ethoxy-oxoethyl amino group. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of the carboxylic acid group. The ethoxy group may enhance its lipophilicity, influencing its biological activity and interaction with cellular membranes. The compound may also display acidic behavior, with the carboxylic acid group capable of donating protons in solution. Its unique structure suggests potential applications in pharmaceuticals or as a biochemical probe, although specific biological activities would depend on further empirical studies. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₁₁H₁₃NO₄

InChI: InChI=1/C11H13NO4/c1-2-16-10(13)7-12-9-6-4-3-5-8(9)11(14)15/h3-6,12H,2,7H2,1H3,(H,14,15)

SMILES: CCOC(=O)CNc1ccccc1C(=O)O

Synonyms:

• Benzoic Acid, 2-[(2-Ethoxy-2-Oxoethyl)Amino]-
• 2-[(2-Ethoxy-2-oxoethyl)amino]benzoic acid

2-[(2-Ethoxy-2-oxoethyl)amino]benzoic acid

CAS: 65992-17-8

2-[(2-Ethoxy-2-oxoethyl)amino]benzoic acid

Purity: 98%

Ref: 54-OR1037604

2-[(2-ethoxy-2-oxoethyl)amino]benzoic acid

CAS: 65992-17-8

Formula: C₁₁H₁₃NO₄

Purity: 98%

Molecular weight: 223.228

Ref: 10-F315999