CAS 65995-64-4: Punicalin
Description:Punicalin is a polyphenolic compound primarily found in pomegranate (Punica granatum) and is known for its potential health benefits. It belongs to a class of compounds called ellagitannins, which are characterized by their complex structure that includes multiple phenolic units. Punicalin exhibits antioxidant properties, which can help neutralize free radicals and reduce oxidative stress in biological systems. Additionally, it has been studied for its anti-inflammatory, antimicrobial, and anticancer activities, making it of interest in nutritional and pharmaceutical research. The compound is soluble in water and organic solvents, which facilitates its absorption and bioavailability in the human body. Its potential health benefits are attributed to its ability to modulate various biochemical pathways, including those involved in cell signaling and gene expression. Overall, punicalin represents a significant area of study in the context of functional foods and natural products, highlighting the importance of plant-derived compounds in promoting health and preventing disease.
Formula:C34H22O22
InChI:InChI=1S/C34H22O22/c35-3-9(38)21(42)28-10(39)4-53-31(49)5-1-7(36)19(40)22(43)11(5)13-17-15-16-18(34(52)56-29(15)26(47)24(13)45)14(25(46)27(48)30(16)55-33(17)51)12-6(32(50)54-28)2-8(37)20(41)23(12)44/h1-3,9-10,21,28,36-48H,4H2
InChI key:InChIKey=GXGFDWGVOITBNW-UHFFFAOYSA-N
SMILES:O=CC(O)C(O)C1OC(=O)C2=CC(O)=C(O)C(O)=C2C3=C(O)C(O)=C4OC(=O)C=5C(=C(O)C(O)=C6OC(=O)C3=C4C65)C7=C(O)C(O)=C(O)C=C7C(=O)OCC1O
- Synonyms:
- 2,20,1,23-(Epoxy[2]propene[1,2]diyl[3]ylidene)-11H,15H-tribenzo[g,i,q][1,5,12]trioxacyclononadecin, <span class="text-smallcaps">D</span>-glucose deriv.
- 3,4,5,11,12,13,21,22,23,26,27,38,39-Tridecahydroxy-9,14,17,29,36-Pentaoxaoctacyclo[29.8.0.02,7
- <span class="text-smallcaps">D</span>-Glucose, cyclic 4,6-[(2S,2′S)-2,2′-(5,10-dihydro-2,3,7,8-tetrahydroxy-5,10-dioxo[1]benzopyrano[5,4,3-cde][1]benzopyran-1,6-diyl)bis[3,4,5-trihydroxybenzoate]]
- Punicalin
- [1]Benzopyrano[5,4,3-cde][1]benzopyran, <span class="text-smallcaps">D</span>-glucose deriv.
- 2,20,1,23-(Epoxy[2]propene[1,2]diyl[3]ylidene)-11H,15H-tribenzo[g,i,q][1,5,12]trioxacyclononadecin, D-glucose deriv.
- [1]Benzopyrano[5,4,3-cde][1]benzopyran, D-glucose deriv.
- D-Glucose, cyclic 4,6-[(2S,2′S)-2,2′-(5,10-dihydro-2,3,7,8-tetrahydroxy-5,10-dioxo[1]benzopyrano[5,4,3-cde][1]benzopyran-1,6-diyl)bis[3,4,5-trihydroxybenzoate]]
