CAS 65996-21-6

3-Pyridinecarbonitrile, 2-bromo-5-methyl-4-phenyl-

Description:

3-Pyridinecarbonitrile, 2-bromo-5-methyl-4-phenyl- is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a cyano group (-C≡N) attached to the pyridine, contributing to its reactivity and potential applications in various chemical syntheses. The presence of a bromine atom at the 2-position and a methyl group at the 5-position, along with a phenyl group at the 4-position, indicates that it is a substituted pyridine, which can influence its physical and chemical properties, such as solubility and boiling point. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. Additionally, the presence of multiple functional groups suggests potential for further chemical modifications. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks or environmental hazards.

Formula: C₁₃H₉BrN₂

InChI: InChI=1S/C13H9BrN2/c1-9-8-16-13(14)11(7-15)12(9)10-5-3-2-4-6-10/h2-6,8H,1H3

InChI key: InChIKey=FIQSIKMZGGEQFZ-UHFFFAOYSA-N

SMILES: C(#N)C=1C(=C(C)C=NC1Br)C2=CC=CC=C2

Synonyms:

• 2-Bromo-5-methyl-4-phenylpyridine-3-carbonitrile
• 2-Bromo-5-methyl-4-phenylnicotinonitrile
• 3-Pyridinecarbonitrile, 2-bromo-5-methyl-4-phenyl-