CAS 65999-76-0

N-(3-amino-2-methylphenyl)acetamide

Description:

N-(3-amino-2-methylphenyl)acetamide, also known by its CAS number 65999-76-0, is an organic compound characterized by the presence of an acetamide functional group attached to a substituted aniline. This compound features an amino group (-NH2) and a methyl group (-CH3) on the aromatic ring, which influences its chemical reactivity and solubility. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine and amide functionalities. The compound can participate in various chemical reactions, including acylation and amination, making it useful in synthetic organic chemistry. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of compounds with biological activity. Additionally, the presence of both amino and acetamide groups may contribute to its ability to form hydrogen bonds, affecting its physical properties such as melting point and boiling point. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₉H₁₂N₂O

InChI: InChI=1/C9H12N2O/c1-6-8(10)4-3-5-9(6)11-7(2)12/h3-5H,10H2,1-2H3,(H,11,12)

SMILES: Cc1c(cccc1N=C(C)O)N

Synonyms:

• Acetamide, N-(3-amino-2-methylphenyl)-

N-(3-Amino-2-methylphenyl)acetamide

CAS: 65999-76-0

Versatile small molecule scaffold

Formula: C₉H₁₂N₂O

Purity: Min. 95%

Molecular weight: 164.2 g/mol

Ref: 3D-QCA99976