CAS 65999-78-2

N-(3-amino-4-methylphenyl)propanamide

Description:

N-(3-amino-4-methylphenyl)propanamide, also known by its CAS number 65999-78-2, is an organic compound characterized by its amide functional group and an aromatic ring. This substance features a propanamide backbone, where the amide nitrogen is substituted with a 3-amino-4-methylphenyl group, indicating the presence of both an amino group and a methyl group on the aromatic ring. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amide and amino groups, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals or as a building block in organic synthesis, particularly in the development of biologically active compounds. The presence of the amino group may also impart basic properties, influencing its reactivity and interactions in various chemical environments. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and risk management.

Formula: C₁₀H₁₄N₂O

InChI: InChI=1/C10H14N2O/c1-3-10(13)12-8-5-4-7(2)9(11)6-8/h4-6H,3,11H2,1-2H3,(H,12,13)

SMILES: CCC(=Nc1ccc(C)c(c1)N)O

N-(3-Amino-4-methylphenyl)propanamide

CAS: 65999-78-2

Versatile small molecule scaffold

Formula: C₁₀H₁₄N₂O

Purity: Min. 95%

Molecular weight: 178.23 g/mol

Ref: 3D-QCA99978