CAS 66-72-8
:Pyridoxal
Description:
Pyridoxal, with the CAS number 66-72-8, is a biologically active form of vitamin B6, playing a crucial role in various enzymatic reactions within the body. It is a yellow crystalline compound that is soluble in water and alcohol but less soluble in non-polar solvents. Pyridoxal serves as a coenzyme in amino acid metabolism, facilitating the transamination, decarboxylation, and racemization of amino acids. Its structure features a pyridine ring with an aldehyde group, which is essential for its reactivity and biological function. Pyridoxal can be phosphorylated to form pyridoxal phosphate, the active coenzyme form that participates in numerous metabolic pathways. Additionally, it exhibits antioxidant properties and is involved in the synthesis of neurotransmitters, such as serotonin and dopamine. Deficiency in pyridoxal can lead to various health issues, including anemia, peripheral neuropathy, and impaired immune function. Overall, pyridoxal is vital for maintaining metabolic health and supporting various physiological processes.
Formula:C8H9NO3
InChI:InChI=1/C8H9NO3/c1-5-8(12)7(4-11)6(3-10)2-9-5/h2,4,10,12H,3H2,1H3
InChI key:InChIKey=RADKZDMFGJYCBB-UHFFFAOYSA-N
SMILES:C(=O)C=1C(CO)=CN=C(C)C1O
Synonyms:- 3-Hydroxy-5-(Hydroxymethyl)-2-Methylpyridine-4-Carbaldehyde
- 3-Hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinecarboxaldehyde
- 3-Hydroxy-5-(hydroxymethyl)-2-methylisonicotinaldehyde
- 3-Hydroxy-5-(hydroxymethyl)-2-methylpyridine-4-carboxaldehyde
- 3-Hydroxy-5-hydroxymethyl-2-methyl-4-pyridincarbaldehyd
- 3-Hydroxy-5-hydroxymethyl-2-methyl-pyridine-4-carbaldehyde
- 3-Hydroxy-5-hydroxymethyl-2-methylisonicotin aldehyde
- 4-Pyridinecarboxaldehyde, 3-hydroxy-5-(hydroxymethyl)-2-methyl-
- 4-Pyridinecarboxaldehyde, 3-hydroxy-5-(hydroxymethyl)-2-methyl- (9CI)
- Brn 0383768
- Nsc 19613
- Piridoxal
- Pyridoxaldehyde
- Unii-3Thm379K8A
- 5-21-13-00044 (Beilstein Handbook Reference)
- Pyridoxal
- 3-Hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinecarbaldehyde
- 2-Methyl-3-hydroxy-5-(hydroxymethyl)pyridine-4-carbaldehyde
- PYRIDOXALE
- 3-(Hydroxymethyl)-5-hydroxy-6-methylpyridine-4-carbaldehyde
- 3-hydroxy-2-methyl-5-methylol-isonicotinaldehyde
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Pyridoxal
CAS:Pyridoxal represents an active form of vitamin B6 [1].Formula:C8H9NO3Purity:99.83%Color and Shape:SolidMolecular weight:167.163-Hydroxy-5-(hydroxymethyl)-2-methyl-pyridine-4-carbaldehyde
CAS:3-Hydroxy-5-(hydroxymethyl)-2-methyl-pyridine-4-carbaldehyde (3HMPA) is a natural compound that has been shown to have tissue nonspecific effects on the bowel. It is structurally similar to pyridoxal, an amino acid present in food, and may have a role in the synthesis of proteins. 3HMPA has also been shown to be an effective treatment for infectious diseases such as HIV and tuberculosis. 3HMPA binds metal ions by chelation and inhibits the growth of bacteria by inhibiting glutamate production. This compound has also been shown to stimulate physiological responses in mice, including increased heart rate and blood pressure.
Formula:C8H9NO3Purity:Min. 95%Molecular weight:167.16 g/mol




