CAS 660-53-7
:(T-4)-(Benzenamine)trifluoroboron
Description:
(T-4)-(Benzenamine)trifluoroboron, also known by its CAS number 660-53-7, is a chemical compound that features a trifluoroboron group attached to a benzenamine moiety. This compound is characterized by its unique structure, which includes a benzene ring substituted with an amino group (aniline) and a trifluoroborane group. The presence of the trifluoroboron moiety imparts distinctive properties, such as increased reactivity and potential applications in various fields, including organic synthesis and materials science. The compound is typically a solid at room temperature and may exhibit solubility in polar organic solvents. Its reactivity can be influenced by the electron-withdrawing nature of the trifluoroboron group, which can affect the electronic properties of the aniline component. Additionally, this compound may be utilized in the development of boron-containing materials or as a reagent in chemical reactions, particularly in the context of boron chemistry. Safety precautions should be observed when handling this compound due to its potential reactivity and toxicity.
Formula:C6H7BF3N
InChI:InChI=1S/C6H7BF3N/c8-7(9,10)11-6-4-2-1-3-5-6/h1-5H,11H2
InChI key:InChIKey=VVPMIAKJDMDELQ-UHFFFAOYSA-N
SMILES:[NH2]([B+3]([F-])([F-])[F-])C1=CC=CC=C1
Synonyms:- Boron fluoride (BF3), compd. with aniline (1:1)
- Boron, (benzenamine)trifluoro-, (T-4)-
- Benzenamine, compd. with trifluoroborane (1:1)
- Aniline, compd. with boron fluoride (BF3) (1:1)
- Aniline, compd. with BF3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
