CAS 66000-41-7

1H-Pyrazol-3-amine, 1-[3-(trifluoromethyl)phenyl]-

Description:

1H-Pyrazol-3-amine, 1-[3-(trifluoromethyl)phenyl]- is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of the trifluoromethyl group (-CF3) attached to a phenyl ring significantly influences its chemical properties, enhancing its lipophilicity and potentially its biological activity. This compound is typically used in medicinal chemistry and research due to its potential as a pharmacophore in drug development. It may exhibit various biological activities, including anti-inflammatory or anticancer properties, depending on its specific interactions with biological targets. The trifluoromethyl group can also enhance the stability and metabolic profile of the compound. Additionally, 1H-Pyrazol-3-amine derivatives are often explored for their applications in agrochemicals and materials science. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity.

Formula: C₁₀H₈F₃N₃

InChI: InChI=1S/C10H8F3N3/c11-10(12,13)7-2-1-3-8(6-7)16-5-4-9(14)15-16/h1-6H,(H2,14,15)

InChI key: InChIKey=LCLWEOIMXMEDKX-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(C=CC1)N2N=C(N)C=C2

Synonyms:

• 1-[3-(Trifluoromethyl)phenyl]-1H-pyrazol-3-amine
• 1-(3-Trifluoromethyl-phenyl)-1H-pyrazol-3-ylamine
• 1H-Pyrazol-3-amine, 1-[3-(trifluoromethyl)phenyl]-

1-[3-(Trifluoromethyl)phenyl]-1H-pyrazol-3-amine

CAS: 66000-41-7

Versatile small molecule scaffold

Formula: C₁₀H₈F₃N₃

Purity: Min. 95%

Molecular weight: 227.19 g/mol

Ref: 3D-RCA00041