CAS 6601-66-7

6-Demethoxytangeretin

Description:

6-Demethoxytangeretin is a flavonoid compound belonging to the class of polymethoxyflavones, which are primarily found in citrus fruits. This compound is characterized by its unique chemical structure, which includes multiple methoxy groups that contribute to its biological activity. It is known for its potential health benefits, including antioxidant, anti-inflammatory, and anticancer properties. The presence of these functional groups enhances its solubility and bioavailability, making it a subject of interest in nutritional and pharmaceutical research. Additionally, 6-Demethoxytangeretin has been studied for its ability to modulate various signaling pathways, which may have implications for disease prevention and treatment. Its natural occurrence in citrus peels also makes it a candidate for dietary supplementation. Overall, 6-Demethoxytangeretin exemplifies the diverse roles that flavonoids play in health and disease, highlighting the importance of plant-derived compounds in modern medicine.

Formula: C₁₉H₁₈O₆

InChI: InChI=1S/C19H18O6/c1-21-12-7-5-11(6-8-12)14-9-13(20)17-15(22-2)10-16(23-3)18(24-4)19(17)25-14/h5-10H,1-4H3

InChI key: InChIKey=DDGJUTBQQURRGE-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(=C(OC)C=C1OC)C(=O)C=C(O2)C3=CC=C(OC)C=C3

5,7,8,4''-TETRAMETHOXYFLAVONE

CAS: 6601-66-7

Formula: C₁₉H₁₈O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 342.3426

Ref: IN-DA00FF7F

6-Demethoxytangeretin

CAS: 6601-66-7

6-Demethoxytangeretin

Purity: ≥98%

Molecular weight: 342.34g/mol

Ref: 54-BUP04818

6-Demethoxytangeretin

CAS: 6601-66-7

Formula: C₁₉H₁₈O₆

Molecular weight: 342.35

Ref: 7W-GY7642

6-Demethoxytangeretin

CAS: 6601-66-7

6-Demethoxytangeretin has anti-inflammatory activity, it also can suppress production and gene expression of interleukin-6 in human mast cell-1 via anaplastic lymphoma kinase and mitogen-activated protein kinase pathways. 6-Demethoxytangeretin can suppress the interleukin 1 (IL-1) induced production of proMMP-9/progelatinase B in rabbit synovial cells in a dose dependent manner (<64 microM).

Formula: C₁₉H₁₈O₆

Purity: 95%~99%

Molecular weight: 342.347

Ref: BP-BP1787

6-Demethoxytangeretin

CAS: 6601-66-7

6-Demethoxytangeretin is a citrus flavonoid isolated from Citrus depressa.

Formula: C₁₉H₁₈O₆

Purity: 99.47% - 99.89%

Color and Shape: Solid

Molecular weight: 342.34

Ref: TM-T8152

5,7,8,4'-Tetramethoxyflavone

CAS: 6601-66-7

5,7,8,4'-Tetramethoxyflavone is a naturally occurring flavone, which is a type of plant-derived polyphenolic compound. It is found in various plants, particularly those belonging to the genus Scutellaria. The compound acts primarily by modulating various cellular signaling pathways, including those involved in inflammation, apoptosis, and oxidative stress. Through its interaction with these pathways, it exhibits potential anti-inflammatory, antioxidant, and anti-cancer properties.

Formula: C₁₉H₁₈O₆

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 342.34 g/mol

Ref: 3D-FT65329