CAS 6601-66-7
:6-Demethoxytangeretin
Description:
6-Demethoxytangeretin is a flavonoid compound belonging to the class of polymethoxyflavones, which are primarily found in citrus fruits. This compound is characterized by its unique chemical structure, which includes multiple methoxy groups that contribute to its biological activity. It is known for its potential health benefits, including antioxidant, anti-inflammatory, and anticancer properties. The presence of these functional groups enhances its solubility and bioavailability, making it a subject of interest in nutritional and pharmaceutical research. Additionally, 6-Demethoxytangeretin has been studied for its ability to modulate various signaling pathways, which may have implications for disease prevention and treatment. Its natural occurrence in citrus peels also makes it a candidate for dietary supplementation. Overall, 6-Demethoxytangeretin exemplifies the diverse roles that flavonoids play in health and disease, highlighting the importance of plant-derived compounds in modern medicine.
Formula:C19H18O6
InChI:InChI=1S/C19H18O6/c1-21-12-7-5-11(6-8-12)14-9-13(20)17-15(22-2)10-16(23-3)18(24-4)19(17)25-14/h5-10H,1-4H3
InChI key:InChIKey=DDGJUTBQQURRGE-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=C(OC)C=C1OC)C(=O)C=C(O2)C3=CC=C(OC)C=C3
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5,7,8,4''-TETRAMETHOXYFLAVONE
CAS:Formula:C19H18O6Purity:98%Color and Shape:SolidMolecular weight:342.34266-Demethoxytangeretin
CAS:6-Demethoxytangeretin has anti-inflammatory activity, it also can suppress production and gene expression of interleukin-6 in human mast cell-1 via anaplastic lymphoma kinase and mitogen-activated protein kinase pathways. 6-Demethoxytangeretin can suppress the interleukin 1 (IL-1) induced production of proMMP-9/progelatinase B in rabbit synovial cells in a dose dependent manner (<64 microM).Formula:C19H18O6Purity:95%~99%Molecular weight:342.3476-Demethoxytangeretin
CAS:6-Demethoxytangeretin is a citrus flavonoid isolated from Citrus depressa.Formula:C19H18O6Purity:99.47% - 99.89%Color and Shape:SolidMolecular weight:342.345,7,8,4'-Tetramethoxyflavone
CAS:5,7,8,4'-Tetramethoxyflavone is a naturally occurring flavone, which is a type of plant-derived polyphenolic compound. It is found in various plants, particularly those belonging to the genus Scutellaria. The compound acts primarily by modulating various cellular signaling pathways, including those involved in inflammation, apoptosis, and oxidative stress. Through its interaction with these pathways, it exhibits potential anti-inflammatory, antioxidant, and anti-cancer properties.
Formula:C19H18O6Purity:Min. 95%Color and Shape:White PowderMolecular weight:342.34 g/molRef: 3D-FT65329
Discontinued product





