CAS 66016-17-9
:Cyclobutanecarboxylic acid, 3-propyl-
Description:
Cyclobutanecarboxylic acid, 3-propyl- is an organic compound characterized by a cyclobutane ring with a propyl group and a carboxylic acid functional group attached. Its molecular structure features a four-membered carbon ring, which contributes to its unique properties, including ring strain that can influence reactivity. The presence of the carboxylic acid group (-COOH) imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and acid-base reactions. The propyl substituent enhances the hydrophobic nature of the molecule, affecting its solubility in polar solvents. Typically, compounds like this may exhibit moderate boiling and melting points due to their molecular weight and structure. Additionally, cyclobutanecarboxylic acid derivatives can be of interest in synthetic organic chemistry and materials science, potentially serving as intermediates in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H14O2
InChI:InChI=1S/C8H14O2/c1-2-3-6-4-7(5-6)8(9)10/h6-7H,2-5H2,1H3,(H,9,10)
InChI key:InChIKey=XYBJCZJXGGQMTQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CC(CCC)C1
Synonyms:- 3-Propylcyclobutanecarboxylic acid
- Cyclobutanecarboxylic acid, 3-propyl-
- 3-Propylcyclobutane-1-carboxylic acid
- 3-n-Propylcyclobutane-1-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3-Propyl-cyclobutanecarboxylic acid
CAS:3-Propyl-cyclobutanecarboxylic acid is a cyclobutane that reacts with bromine to form a brominated liquid crystal. It has a temperature range of -97 °C to 29 °C and can be used as a solvent for organic compounds. 3-Propyl-cyclobutanecarboxylic acid can also be used in preparative chromatography, which is the process of separating different substances by their rate of movement through a column or tube. The use of 3-propyl-cyclobutanecarboxylic acid in preparative chromatography has been shown to be effective for the separation of diethyl malonate and other dicarboxylic acids, as well as other substances. 3-Propyl-cyclobutanecarboxylic acid can also be decarboxylated and hydrolyzed, forming methylmalonic acid.
Formula:C8H14O2Purity:Min. 95%Molecular weight:142.2 g/molRef: 3D-RCA01617
Discontinued product
