CAS 66016-21-5

3-(Phenylmethyl)cyclobutanecarboxylic acid

Description:

3-(Phenylmethyl)cyclobutanecarboxylic acid, identified by its CAS number 66016-21-5, is an organic compound characterized by a cyclobutane ring substituted with a phenylmethyl group and a carboxylic acid functional group. This compound typically exhibits properties associated with both cyclic and aromatic structures, including potential rigidity from the cyclobutane ring and reactivity from the carboxylic acid group. The presence of the phenylmethyl group contributes to its hydrophobic characteristics, while the carboxylic acid imparts acidity and the ability to form hydrogen bonds, influencing its solubility in polar solvents. The compound may participate in various chemical reactions, such as esterification and decarboxylation, and can serve as a building block in organic synthesis. Its structural features suggest potential applications in pharmaceuticals or as intermediates in the synthesis of more complex molecules. However, specific physical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise applications.

Formula: C₁₂H₁₄O₂

InChI: InChI=1S/C12H14O2/c13-12(14)11-7-10(8-11)6-9-4-2-1-3-5-9/h1-5,10-11H,6-8H2,(H,13,14)

InChI key: InChIKey=FUQDLNLCZMLBAD-UHFFFAOYSA-N

SMILES: C(C1CC(C(O)=O)C1)C2=CC=CC=C2

Synonyms:

• 3-Benzylcyclobutane-1-carboxylic acid
• 3-Benzyl-cyclobutanecarboxylic acid
• 3-Benzylcyclobutanecarboxylic acid
• 3-(Phenylmethyl)cyclobutanecarboxylic acid
• Cyclobutanecarboxylic acid, 3-(phenylmethyl)-

3-Benzylcyclobutanecarboxylic acid

CAS: 66016-21-5

Versatile small molecule scaffold

Formula: C₁₂H₁₄O₂

Purity: Min. 95%

Molecular weight: 190.24 g/mol

Ref: 3D-RCA01621