CAS 66016-28-2

3-Phenylcyclobutanecarboxylic acid

Description:

3-Phenylcyclobutanecarboxylic acid is an organic compound characterized by its cyclobutane ring structure, which is substituted with a phenyl group and a carboxylic acid functional group. This compound features a four-membered cyclobutane ring, which contributes to its unique strain and reactivity compared to larger cyclic compounds. The presence of the phenyl group enhances its aromatic characteristics, potentially influencing its solubility and reactivity in various chemical environments. As a carboxylic acid, it exhibits typical acid properties, including the ability to donate protons in solution, which can affect its behavior in chemical reactions and interactions with other substances. The compound may also participate in various organic reactions, such as esterification or amidation, due to the reactive nature of the carboxylic acid group. Its structural features suggest potential applications in organic synthesis, pharmaceuticals, or materials science, although specific applications would depend on further research and development. Overall, 3-Phenylcyclobutanecarboxylic acid represents an interesting compound for study within organic chemistry.

Formula: C₁₁H₁₂O₂

InChI: InChI=1S/C11H12O2/c12-11(13)10-6-9(7-10)8-4-2-1-3-5-8/h1-5,9-10H,6-7H2,(H,12,13)

InChI key: InChIKey=KOSJHQBPJQYNTB-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CC(C1)C2=CC=CC=C2

Synonyms:

• Cyclobutanecarboxylic acid, 3-phenyl-
• 3-Phenylcyclobutanecarboxylic acid
• 3-Phenylcyclobutane-1-carboxylic acid

Cyclobutanecarboxyli​c acid, 3-​phenyl-

CAS: 66016-28-2

Formula: C₁₁H₁₂O₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 176.2118

Ref: IN-DA00FHMU

3-Phenylcyclobutane-1-carboxylic acid

CAS: 66016-28-2

3-Phenylcyclobutane-1-carboxylic acid

Purity: 97%

Color and Shape: Solid

Molecular weight: 176.21g/mol

Ref: 54-OR923203

3-Phenylcyclobutane-1-carboxylic acid

CAS: 66016-28-2

Formula: C₁₁H₁₂O₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 176.215

Ref: 10-F501779

3-phenylcyclobutanecarboxylic acid

CAS: 66016-28-2

3-Phenylcyclobutanecarboxylic acid is a cyclopropylcarbinyl compound with the molecular formula CHCOCO. It has the chemical structure of a carbanion and is an example of keto-enol tautomerism. 3-Phenylcyclobutanecarboxylic acid can be used as a keyword to indicate that the compound is an organic compound containing a cyclopropane ring.

Formula: C₁₁H₁₂O₂

Purity: Min. 95%

Molecular weight: 176.21 g/mol

Ref: 3D-RCA01628