CAS 6602-63-7
:pyridin-2-yl(thiophen-2-yl)methanone
Description:
Pyridin-2-yl(thiophen-2-yl)methanone, with the CAS number 6602-63-7, is an organic compound characterized by the presence of a pyridine ring and a thiophene ring connected through a carbonyl group. This compound typically exhibits a planar structure due to the conjugation between the aromatic rings and the carbonyl, which can enhance its stability and reactivity. It is likely to be a yellow to brown solid at room temperature, with moderate solubility in organic solvents such as ethanol and dichloromethane, but limited solubility in water due to its hydrophobic aromatic components. The presence of both nitrogen in the pyridine and sulfur in the thiophene can impart unique electronic properties, making it of interest in various fields, including pharmaceuticals and materials science. Its reactivity may include electrophilic substitution and nucleophilic addition, which are common for compounds containing aromatic systems. Additionally, it may exhibit biological activity, making it a candidate for further research in medicinal chemistry.
Formula:C10H7NOS
InChI:InChI=1/C10H7NOS/c12-10(9-5-3-7-13-9)8-4-1-2-6-11-8/h1-7H
SMILES:c1ccnc(c1)C(=O)c1cccs1
Synonyms:- Methanone, 2-pyridinyl-2-thienyl-
- Pyridin-2-yl(2-thienyl)methanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Pyridin-2-yl(thiophen-2-yl)methanone
CAS:Formula:C10H7NOSColor and Shape:LiquidMolecular weight:189.23372-[(Thiophen-2-yl)carbonyl]pyridine
CAS:2-[(Thiophen-2-yl)carbonyl]pyridinePurity:≥95%Molecular weight:189.23g/mol2-[(Thiophen-2-yl)carbonyl]pyridine
CAS:2-[(Thiophen-2-yl)carbonyl]pyridine is a diastereoselective, enantiopure, and ligand-free asymmetric synthesis of pyridines from the reaction of amines with anions. The reaction is catalyzed by a chiral tetrafluoroborate salt and proceeds with high yields and diastereoselectivities. This process can be used to synthesize pyridines from anion precursors that are not commercially available or are too expensive for large scale production. 2-[(Thiophen-2-yl)carbonyl]pyridine has been shown to have optical resolution in both the (+) and (-) configurations, which makes it ideal for use in pharmaceuticals or other biological applications.Formula:C10H7NOSPurity:Min. 95%Molecular weight:189.23 g/mol


