CAS 66030-25-9
:(3E)-3-(2-{4-[(2E)-2-iminopyridin-1(2H)-yl]phenyl}hydrazinylidene)-6-oxocyclohexa-1,4-diene-1-carboxylic acid
Description:
The chemical substance known as (3E)-3-(2-{4-[(2E)-2-iminopyridin-1(2H)-yl]phenyl}hydrazinylidene)-6-oxocyclohexa-1,4-diene-1-carboxylic acid, with the CAS number 66030-25-9, is a complex organic compound characterized by its unique structural features. It contains multiple functional groups, including a hydrazine moiety, a pyridine ring, and a carboxylic acid group, which contribute to its potential reactivity and biological activity. The presence of the cyclohexadiene structure suggests that it may exhibit interesting electronic properties, possibly making it a candidate for applications in organic electronics or as a dye. Additionally, the compound's hydrazine and carboxylic acid functionalities may impart properties relevant to medicinal chemistry, such as potential antimicrobial or anticancer activities. Its stereochemistry, indicated by the (3E) and (2E) designations, suggests specific spatial arrangements that could influence its interactions with biological targets. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry, warranting further investigation into its properties and potential applications.
Formula:C18H14N4O3
InChI:InChI=1/C18H14N4O3/c19-17-3-1-2-10-22(17)14-7-4-12(5-8-14)20-21-13-6-9-16(23)15(11-13)18(24)25/h1-11,19-20H,(H,24,25)/b19-17+,21-13+
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Iminopyridyl Sulfasalazine (2-Hydroxy-5-[2-[4-(2-iminopyridin-1(2H)-yl)phenyl]diazenyl]benzoic acid)
CAS:Compounds containing an unfused pyridine ring in the structure, nesoiFormula:C18H14N4O3Color and Shape:Yellow PowderMolecular weight:334.10659Sulfasalazine EP Impurity C
CAS:Formula:C18H14N4O3Color and Shape:Orange SolidMolecular weight:334.34Salicylazoiminopyridine (>85%)
CAS:Controlled Product<p>Impurity Sulfasalazine EP impurity C<br>Applications An impurity of Sulfasalazine (S699084).<br>References Hagel, L.: Anal. Chim. Acta, 96, 293 (1978);<br></p>Formula:C18H14N4O3Purity:>85%Color and Shape:NeatMolecular weight:334.332-Hydroxy-5-[2-[4-(2-imino-1(2H)-pyridinyl)phenyl]diazenyl]-benzoic acid
CAS:<p>2-Hydroxy-5-[2-[4-(2-imino-1(2H)-pyridinyl)phenyl]diazenyl]-benzoic acid (DPC) is a drug product that is used in pharmaceutical research and development. It is an impurity standard for HPLC analysis. DPC has been shown to be a metabolite of the drug product 2,6-dimethoxy-N-(3-methylphenyl)pyrimidine-4,6-diamine (DMX), which is used in the treatment of cancer. Impurities standards are important for ensuring the quality of drugs and ensuring that they are safe for human use. This product can also be synthesized from commercially available amino acids.</p>Formula:C18H14N4O3Purity:85%MinMolecular weight:334.33 g/mol





