CAS 66033-92-9

3-methyl-1,2-benzisoxazol-6-ol

Description:

3-Methyl-1,2-benzisoxazol-6-ol is a chemical compound characterized by its unique structure, which includes a benzisoxazole ring system with a hydroxyl group and a methyl substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the hydroxyl group suggests it may engage in hydrogen bonding, influencing its solubility and reactivity. The methyl group can affect the compound's electronic properties and steric hindrance, which may play a role in its interactions with biological targets. 3-Methyl-1,2-benzisoxazol-6-ol may be of interest in medicinal chemistry due to its potential pharmacological properties, including antimicrobial or anti-inflammatory effects, although specific biological activities would require further investigation. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many organic compounds, safety data should be consulted to understand its handling and toxicity.

Formula: C₈H₇NO₂

InChI: InChI=1/C8H7NO2/c1-5-7-3-2-6(10)4-8(7)11-9-5/h2-4,10H,1H3

SMILES: Cc1c2ccc(cc2on1)O

Synonyms:

• 1,2-Benzisoxazol-6-ol, 3-methyl-
• 3-Methyl-1,2-benzoxazol-6-ol
• 3-Methylbenzo[d]isoxazol-6-ol
• T56 Bonj D1 Hq
• 3-Methyl-1,2-benzisoxazol-6-ol

3-Methyl-1,2-benzisoxazol-6-ol

CAS: 66033-92-9

Formula: C₈H₇NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 149.1467

Ref: IN-DA00FD8Q

3-Methylbenzo[d]isoxazol-6-ol

CAS: 66033-92-9

3-Methylbenzo[d]isoxazol-6-ol

Purity: 95%

Molecular weight: 149.15g/mol

Ref: 54-OR94536

3-Methyl-1,2-benzisoxazol-6-ol

CAS: 66033-92-9

Formula: C₈H₇NO₂

Purity: 95%

Color and Shape: Liquid, No data available.

Molecular weight: 149.149

Ref: 10-F076171