CAS 66048-45-1
:5-fluoro-1-(beta-D-glucopyranuronosyl)pyrimidine-2,4(1H,3H)-dione
Description:
5-Fluoro-1-(beta-D-glucopyranuronosyl)pyrimidine-2,4(1H,3H)-dione is a chemical compound characterized by its pyrimidine core, which is substituted with a fluorine atom and a glucopyranuronosyl group. This compound features a pyrimidine ring, a six-membered sugar derivative, and two carbonyl groups, contributing to its potential biological activity. The presence of the fluorine atom may enhance its pharmacological properties, such as increased metabolic stability or altered binding affinity to biological targets. The glucopyranuronosyl moiety suggests potential interactions with biological systems, particularly in glycosylation processes. This compound may exhibit solubility in polar solvents due to the hydroxyl groups present in the sugar moiety. Its structural features indicate potential applications in medicinal chemistry, particularly in the development of antiviral or anticancer agents. However, specific data regarding its reactivity, stability, and biological activity would require further investigation through experimental studies. Overall, this compound represents a unique intersection of carbohydrate chemistry and heterocyclic chemistry, making it of interest in various research fields.
Formula:C10H11FN2O8
InChI:InChI=1/C10H11FN2O8/c11-2-1-13(10(20)12-7(2)17)8-5(16)3(14)4(15)6(21-8)9(18)19/h1,3-6,8,14-16H,(H,18,19)(H,12,17,20)/t3-,4-,5+,6-,8+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5-Fluorouracil N-β-D-Glucuronide
CAS:Controlled Product<p>Applications 5-Fluorouracil N-β-D-Glucuronide is the N-glucuronide derivative of 5-Fluorouracil (F596010). 5-Fluorouracil N-β-D-Glucuronide unlike its O-glucuronide analog does not possess significant antitumor activity.<br>References Baba, T. et al.: Gann, 69, 283 (1978); Kaneko, M. et al.: Nucleic Acid Res., 3, 35 (1977);<br></p>Formula:C10H11FN2O8Color and Shape:NeatMolecular weight:306.205-Fluorouracil N-b-D-glucuronide
CAS:<p>5-Fluorouracil N-b-D-glucuronide is the major metabolite of 5-fluorouracil. It is mainly excreted in urine and bile, and has a high blood level. The glucuronide conjugate of 5-fluorouracin is hydrolyzed by beta-glucuronidase to generate 5-fluorouridine, which can be reabsorbed into the cell to form cytotoxic 5-fluoro uridine triphosphate. This process inhibits protein synthesis, leading to cell death. The half life of 5FU glucuronide is short and it needs to be constantly replaced with new doses. It has also been shown that levels of 5FU glucuronide are higher in tissues than in plasma, which may explain its inhibitory effect on tumors.</p>Formula:C10H11FN2O8Purity:Min. 95%Molecular weight:306.2 g/mol


