CAS 66048-70-2
:2-amino-5-(aminomethyl)-7-(beta-D-ribofuranosyl)-1,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-one
Description:
2-amino-5-(aminomethyl)-7-(beta-D-ribofuranosyl)-1,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-one, with CAS number 66048-70-2, is a purine analog that exhibits structural features characteristic of nucleosides. This compound contains a pyrrolo[2,3-d]pyrimidine core, which is a bicyclic structure that contributes to its biological activity. The presence of amino groups and a ribofuranosyl moiety suggests potential interactions with biological macromolecules, particularly nucleic acids. This compound is of interest in medicinal chemistry due to its potential role as an antiviral or anticancer agent, as it may interfere with nucleic acid synthesis or function. Its solubility and stability in biological systems can vary, influencing its pharmacokinetic properties. Additionally, the stereochemistry of the ribofuranosyl component may affect its interaction with enzymes and receptors. Overall, this compound represents a class of molecules that can be explored for therapeutic applications, particularly in the context of diseases where nucleic acid metabolism is disrupted.
Formula:C12H17N5O5
InChI:InChI=1/C12H17N5O5/c13-1-4-2-17(9-6(4)10(21)16-12(14)15-9)11-8(20)7(19)5(3-18)22-11/h2,5,7-8,11,18-20H,1,3,13H2,(H3,14,15,16,21)/t5-,7-,8-,11-/m1/s1
SMILES:C(c1cn(c2c1c(nc(=N)[nH]2)O)[C@H]1[C@@H]([C@@H]([C@@H](CO)O1)O)O)N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
7-(Aminomethyl)-7-deazaguanosine
CAS:Controlled ProductFormula:C12H17N5O5Color and Shape:NeatMolecular weight:311.2947-(Aminomethyl)-7-deazaguanosine
CAS:<p>7-Aminomethyl-7-deazaguanosine is a nucleoside that is classified as a purine. It can be synthesized from 7-amino-7-deazaguanosine and sodium periodate. The chemical reactions involved in the synthesis are oxidation of the amine group on the 7-amino group to form an iminium ion and subsequent nucleophilic attack by the hydroxyl group on the N9 position of the purine ring to form an amino alcohol. This nucleoside has been shown to bind to ribosomes and inhibit protein synthesis, which suggests that it may have potential for use as an antibiotic or anticancer agent. 7-Aminomethyl-7-deazaguanosine has also been shown to cause epigenetic changes such as DNA methylation, histone modification, and alterations in chromatin structure.</p>Formula:C12H17N5O5Purity:Min. 95%Molecular weight:311.29 g/mol

