CAS 66056-19-7
:Licoisoflavone A
Description:
Licoisoflavone A, with the CAS number 66056-19-7, is a naturally occurring flavonoid primarily found in the roots of Glycyrrhiza species, particularly licorice. This compound is characterized by its polyphenolic structure, which contributes to its antioxidant properties. Licoisoflavone A exhibits a range of biological activities, including anti-inflammatory, anti-cancer, and neuroprotective effects, making it of interest in pharmacological research. Its mechanism of action often involves modulation of various signaling pathways and inhibition of specific enzymes. Additionally, Licoisoflavone A has been studied for its potential benefits in metabolic disorders and cardiovascular health. The compound is typically soluble in organic solvents and has limited solubility in water, which is common for many flavonoids. As research continues, Licoisoflavone A may hold promise for therapeutic applications, although further studies are needed to fully elucidate its efficacy and safety in clinical settings.
Formula:C20H18O6
InChI:InChI=1S/C20H18O6/c1-10(2)3-4-13-15(22)6-5-12(19(13)24)14-9-26-17-8-11(21)7-16(23)18(17)20(14)25/h3,5-9,21-24H,4H2,1-2H3
InChI key:InChIKey=KCUZCRLRQVRBBV-UHFFFAOYSA-N
SMILES:O=C1C(=COC=2C1=C(O)C=C(O)C2)C3=C(O)C(CC=C(C)C)=C(O)C=C3
Synonyms:- 3-[2,4-Dihydroxy-3-(3-methyl-2-buten-1-yl)phenyl]-5,7-dihydroxy-4H-1-benzopyran-4-one
- 3-[2,4-Dihydroxy-3-(3-methyl-but-2-enyl)-phenyl]-5,7-dihydroxy-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 3-[2,4-dihydroxy-3-(3-methyl-2-buten-1-yl)phenyl]-5,7-dihydroxy-
- 4H-1-Benzopyran-4-one, 3-[2,4-dihydroxy-3-(3-methyl-2-butenyl)phenyl]-5,7-dihydroxy-
- Lico-iso-flavone A
- Licoisoflavone A
- Phaseoluteone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Licoisoflavone A
CAS:Licoisoflavone A (Phaseoluteone) is an MRP inhibitor and inhibits lipid peroxidation with an IC50 of 7.2 μM.Formula:C20H18O6Purity:99.71%Color and Shape:SolidMolecular weight:354.35Licoisoflavone A
CAS:Licoisoflavone A is a naturally occurring isoflavone, which is extracted from plants of the Glycyrrhiza genus, notably known for their medicinal applications. This compound exhibits a unique mode of action, primarily through its anti-inflammatory and antioxidant activities, which involve modulation of various signaling pathways and inhibition of pro-inflammatory cytokines. By influencing these pathways, Licoisoflavone A can mitigate oxidative stress and reduce inflammation, showcasing its potential in therapeutic applications.Purity:Min. 95%




