CAS 66056-20-0
:Gomisin H
Description:
Gomisin H is a chemical compound classified as a lignan, which is a type of polyphenolic compound commonly found in various plants, particularly in the fruits and seeds of certain species. It is known for its potential pharmacological properties, including antioxidant, anti-inflammatory, and neuroprotective effects. Gomisin H has garnered interest in the field of medicinal chemistry due to its ability to interact with various biological pathways, potentially offering therapeutic benefits in conditions such as neurodegenerative diseases and cancer. The compound is typically characterized by its complex molecular structure, which includes multiple aromatic rings and hydroxyl groups that contribute to its biological activity. Additionally, Gomisin H is soluble in organic solvents, which can facilitate its extraction from plant sources. Research continues to explore its mechanisms of action and potential applications in health and medicine, making it a subject of interest in both natural product chemistry and pharmacology.
Formula:C23H30O7
InChI:InChI=1S/C23H30O7/c1-12-8-13-9-15(26-3)20(28-5)19(24)17(13)18-14(11-23(12,2)25)10-16(27-4)21(29-6)22(18)30-7/h9-10,12,24-25H,8,11H2,1-7H3
InChI key:InChIKey=NLJJSPKWNBUDNS-UHFFFAOYSA-N
SMILES:O(C)C1=C2C=3C(=CC(OC)=C(OC)C3O)CC(C)C(C)(O)CC2=CC(OC)=C1OC
Synonyms:- (6S,7S,12aR)-5,6,7,8-Tetrahydro-2,3,10,11,12-pentamethoxy-6,7-dimethyldibenzo[a,c]cyclooctene-1,7-diol
- Dibenzo[a,c]cyclooctene-1,7-diol,5,6,7,8-tetrahydro-2,3,10,11,12-pentamethoxy-6,7-dimethyl-, stereoisomer
- Gomisin H
- Dibenzo[a,c]cyclooctene-1,7-diol, 5,6,7,8-tetrahydro-2,3,10,11,12-pentamethoxy-6,7-dimethyl-, (6S,7S,12aR)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Gomisin H
CAS:Gomisin H, a compound from Schizandra chinensis, exhibits antioxidant, neuroprotective, hepatoprotective, antibacterial, antiviral, antidiabetic, and anticancer bioactivities.Formula:C23H30O7Purity:99.99%Color and Shape:SolidMolecular weight:418.49Gomisin H
CAS:Controlled ProductGomisin H is a natural compound that belongs to the group of fructus. It has antiproliferation activity against human breast cancer cells and inhibits skin tumor formation in mice. Gomisin H has been shown to suppress the proliferation of T47D cells by targeting drug transporter proteins, which are involved in transporting drugs into cells. Gomisin H also inhibits the growth of breast cancer cells by interfering with their ability to synthesize DNA. The chemical structure of gomisin H is similar to that of the well-known anticancer drug camptothecin, but it has a longer detection time.Purity:Min. 95%



