CAS 66056-23-3
:Benzoylgomisin H
Description:
Benzoylgomisin H, with the CAS number 66056-23-3, is a chemical compound that belongs to the class of natural products known as lignans. It is derived from various plant sources and is characterized by its complex molecular structure, which typically includes aromatic rings and functional groups that contribute to its biological activity. This compound is noted for its potential pharmacological properties, including antioxidant and anti-inflammatory effects, which have garnered interest in medicinal chemistry and natural product research. The presence of the benzoyl group in its structure is significant, as it can influence the compound's reactivity and interaction with biological targets. Additionally, Benzoylgomisin H may exhibit varying solubility in organic solvents and water, depending on its specific structural features. As with many natural products, its extraction and purification can be challenging, but it holds promise for further investigation in the fields of pharmacology and biochemistry.
Formula:C30H34O8
InChI:InChI=1S/C30H34O8/c1-17-13-19-14-21(33-3)26(36-6)28(38-29(31)18-11-9-8-10-12-18)23(19)24-20(16-30(17,2)32)15-22(34-4)25(35-5)27(24)37-7/h8-12,14-15,17,32H,13,16H2,1-7H3
InChI key:InChIKey=AZQOQICAWOAGEN-UHFFFAOYSA-N
SMILES:O(C(=O)C1=CC=CC=C1)C2=C3C=4C(=CC(OC)=C(OC)C4OC)CC(C)(O)C(C)CC3=CC(OC)=C2OC
Synonyms:- Benzoylgomisin H
- Dibenzo[a,c]cyclooctene-1,7-diol, 5,6,7,8-tetrahydro-2,3,10,11,12-pentamethoxy-6,7-dimethyl-, 1-benzoate, (6S,7S,12aR)-
- Dibenzo[a,c]cyclooctene-1,7-diol, 5,6,7,8-tetrahydro-2,3,10,11,12-pentamethoxy-6,7-dimethyl-, 1-benzoate, stereoisomer
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Benzoylgomisin H
CAS:Benzoylgomisin H is a natural product from Schizandra chinensis.Formula:C30H34O8Purity:98%Color and Shape:SolidMolecular weight:522.594Benzoylgomisin H
CAS:Controlled ProductGomisin H is a benzoyl derivative of the natural compound protocatechuic acid. This non-selective cation is able to permeate cell membranes and inhibit the transport of certain drugs, such as multidrugs, through the cell membrane. Gomisin H has been shown to be a potent antioxidant and to have an inhibitory effect on cancer cells in vitro. The apoptotic cell death process can be induced by gomisin H in cancer cells, but not in healthy cells.
Formula:C30H34O8Purity:Min. 95%Molecular weight:522.6 g/mol


