CAS 66056-30-2

5,5',7-trihydroxy-2',2'-dimethyl-2'H,4H-3,6'-bichromen-4-one

Description:

5,5',7-trihydroxy-2',2'-dimethyl-2'H,4H-3,6'-bichromen-4-one, also known by its CAS number 66056-30-2, is a naturally occurring flavonoid compound characterized by its complex polyphenolic structure. This substance features multiple hydroxyl groups, which contribute to its antioxidant properties, making it of interest in various biological and pharmacological studies. The presence of dimethyl groups enhances its lipophilicity, potentially influencing its bioavailability and interaction with biological membranes. The compound exhibits a unique chromone backbone, which is typical of many flavonoids, and is known for its potential health benefits, including anti-inflammatory and anticancer activities. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in research and potential therapeutic uses. Overall, this compound represents a significant area of interest in natural product chemistry and medicinal research due to its diverse biological activities and structural complexity.

Formula: C₂₀H₁₆O₆

InChI: InChI=1/C20H16O6/c1-20(2)6-5-12-15(26-20)4-3-11(18(12)23)13-9-25-16-8-10(21)7-14(22)17(16)19(13)24/h3-9,21-23H,1-2H3

SMILES: CC1(C)C=Cc2c(ccc(c3coc4cc(cc(c4c3=O)O)O)c2O)O1

Synonyms:

• Lico-iso-flavone B
• 5,7-Dihydroxy-3-(5-hydroxy-2,2-dimethyl-2H-1-benzopyran-6-yl)-4H-1-benzopyran-4-one
• Licoisoflavone B
• 5,7-dihydroxy-3-(5-hydroxy-2,2-dimethylchromen-6-yl)chromen-4-one
• 4H-1-Benzopyran-4-one, 5,7-dihydroxy-3-(5-hydroxy-2,2-dimethyl-2H-1-benzopyran-6-yl)-

5,7-Dihydroxy-3-(5-hydroxy-2,2-dimethyl-2H-1-benzopyran-6-yl)-4H-1-benzopyran-4-one

CAS: 66056-30-2

Formula: C₂₀H₁₆O₆

Purity: 99%

Color and Shape: Solid

Molecular weight: 352.3374

Ref: IN-DA00FGMK

Licoisoflavone B

CAS: 66056-30-2

Licoisoflavone B

Purity: ≥98%

Molecular weight: 352.34g/mol

Ref: 54-BUP20824

Licoisoflavone B

CAS: 66056-30-2

Formula: C₂₀H₁₆O₆

Purity: 95%~99%

Molecular weight: 352.342

Ref: BP-SBP03375

Licoisoflavone B

CAS: 66056-30-2

Licoisoflavone B is an isoflavonoid from Glycyrrhiza uralensis Fisch that inhibits lipid peroxidation and inhibits the human cytochrome P450 enzyme.

Formula: C₂₀H₁₆O₆

Purity: 99.79%

Color and Shape: Solid

Molecular weight: 352.34

Ref: TM-TN1864

Licoisoflavone B

CAS: 66056-30-2

Licoisoflavone B is a naturally occurring isoflavone, which is a type of flavonoid compound. It is primarily sourced from various species of Glycyrrhiza, also known as licorice plants. The compound is extracted from the roots of these plants, which have been used in traditional medicine systems for their therapeutic properties.

Formula: C₂₀H₁₆O₆

Purity: Min. 95%

Molecular weight: 352.3 g/mol

Ref: 3D-RCA05630