CAS 66065-60-9
:1-thia-4-azaspiro[4.5]decane-3-carboxylic acid
Description:
1-Thia-4-azaspiro[4.5]decane-3-carboxylic acid is a heterocyclic compound characterized by its unique spirocyclic structure, which incorporates both sulfur and nitrogen atoms within its ring system. The presence of a carboxylic acid functional group contributes to its acidity and potential reactivity, making it a candidate for various chemical reactions, including esterification and amidation. The spiro structure, which consists of two rings sharing a single atom, imparts rigidity and can influence the compound's biological activity and pharmacological properties. This compound may exhibit interesting interactions with biological targets due to its structural features, potentially leading to applications in medicinal chemistry. Additionally, the presence of the thia (sulfur) and aza (nitrogen) components can enhance its solubility and stability in various solvents. Overall, 1-thia-4-azaspiro[4.5]decane-3-carboxylic acid represents a class of compounds that may be explored for their therapeutic potential and utility in synthetic chemistry.
Formula:C9H15NO2S
InChI:InChI=1/C9H15NO2S/c11-8(12)7-6-13-9(10-7)4-2-1-3-5-9/h7,10H,1-6H2,(H,11,12)
SMILES:C1CCC2(CC1)NC(CS2)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.