CAS 66065-96-1
:6-amino-3-{[3-deoxy-4-C-methyl-3-(methylamino)pentopyranosyl]oxy}-2,4-dihydroxycyclohexyl 2,6-diamino-2,3,4,6-tetradeoxyhexopyranoside
Description:
6-amino-3-{[3-deoxy-4-C-methyl-3-(methylamino)pentopyranosyl]oxy}-2,4-dihydroxycyclohexyl 2,6-diamino-2,3,4,6-tetradeoxyhexopyranoside, with CAS number 66065-96-1, is a complex organic compound characterized by its intricate structure that includes multiple amino and hydroxyl functional groups. This compound features a cyclohexyl moiety, which contributes to its cyclic structure, and is linked to a sugar derivative, indicating potential biological activity, particularly in the context of glycosylation. The presence of amino groups suggests that it may participate in various biochemical interactions, possibly acting as a substrate or inhibitor in enzymatic reactions. Its specific stereochemistry and functional groups may influence its solubility, reactivity, and interaction with biological systems. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in the development of antibiotics or other therapeutic agents. Understanding its properties, including stability and reactivity under different conditions, is crucial for exploring its practical applications in medicinal chemistry and biochemistry.
Formula:C19H38N4O8
InChI:InChI=1/C19H38N4O8/c1-19(27)7-28-18(13(26)16(19)23-2)31-15-11(24)5-10(22)14(12(15)25)30-17-9(21)4-3-8(6-20)29-17/h8-18,23-27H,3-7,20-22H2,1-2H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Deamino-1-hydroxygentamicin C1a
CAS:<p>1-Deamino-1-hydroxygentamicin C1a (AntibioticSU-2) is an aminoglycoside antibiotic effective against both gram-positive and gram-negative bacteria.</p>Formula:C19H38N4O8Color and Shape:SolidMolecular weight:450.527
