CAS 66067-26-3

5,5',7-trihydroxy-2',2'-dimethyl-2,3-dihydro-2'H,4H-3,6'-bichromen-4-one

Description:

5,5',7-trihydroxy-2',2'-dimethyl-2,3-dihydro-2'H,4H-3,6'-bichromen-4-one, with CAS number 66067-26-3, is a complex organic compound belonging to the class of flavonoids, specifically a type of biflavonoid. This substance features multiple hydroxyl groups, which contribute to its potential antioxidant properties. The presence of dimethyl groups indicates that it has a branched structure, enhancing its solubility and reactivity. The compound's bicyclic structure, characteristic of flavonoids, suggests it may exhibit various biological activities, including anti-inflammatory and antimicrobial effects. Its unique arrangement of functional groups may also influence its interaction with biological systems, making it a subject of interest in pharmacological research. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature, which are important considerations in its application in natural product chemistry and potential therapeutic uses. Overall, this compound exemplifies the diverse chemistry of flavonoids and their significance in both natural and synthetic contexts.

Formula: C₂₀H₁₈O₆

InChI: InChI=1/C20H18O6/c1-20(2)6-5-12-15(26-20)4-3-11(18(12)23)13-9-25-16-8-10(21)7-14(22)17(16)19(13)24/h3-8,13,21-23H,9H2,1-2H3

SMILES: CC1(C)C=Cc2c(ccc(C3COc4cc(cc(c4C3=O)O)O)c2O)O1

Synonyms:

• Lico-iso-flavanone

Licoisoflavanone

CAS: 66067-26-3

Licoisoflavanone is a natural product from Licorice.

Formula: C₂₀H₁₈O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 354.35

Ref: TM-TN4434

Licoisoflavanone

CAS: 66067-26-3

Formula: C₂₀H₁₈O₆

Purity: 95%~99%

Molecular weight: 354.358

Ref: BP-SBP03780

Licoisoflavanone

CAS: 66067-26-3

Licoisoflavanone is a naturally occurring flavonoid compound, which is derived from the roots of plants such as Glycyrrhiza glabra, commonly known as licorice. This phytochemical is primarily obtained through extraction and isolation from licorice roots, where it is present as part of a complex mixture of bioactive compounds. The mode of action of licoisoflavanone involves its ability to interact with various biological pathways, including inhibitory effects on bacterial cell wall synthesis and disruption of microbial cellular functions, as well as scavenging free radicals to exert antioxidant effects.

Formula: C₂₀H₁₈O₆

Purity: Min. 95%

Molecular weight: 354.4 g/mol

Ref: 3D-RCA06726

5,7,5'-TRIHYDROXY-2',2'-DIMETHYL-2,3-DIHYDRO-2'H-[3,6']BI[1-BENZOPYRANYL]-4-ONE

CAS: 66067-26-3

Formula: C₂₀H₁₈O₆

Purity: 97.0%

Molecular weight: 354.3533

Ref: IN-DA006KGZ