CAS 66067-41-2
:2-(2-fluoro-3',4'-dihydroxybiphenyl-4-yl)propanoic acid
Description:
2-(2-Fluoro-3',4'-dihydroxybiphenyl-4-yl)propanoic acid, with the CAS number 66067-41-2, is a chemical compound characterized by its biphenyl structure, which features a fluorine atom and two hydroxyl groups on the aromatic rings. This compound is classified as a propanoic acid derivative, indicating the presence of a carboxylic acid functional group. The fluorine substitution can influence the compound's reactivity and biological activity, potentially enhancing its lipophilicity and altering its interaction with biological targets. The hydroxyl groups contribute to its polarity and may participate in hydrogen bonding, affecting solubility and stability in various solvents. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in the design of compounds targeting specific biological pathways. Overall, the unique combination of functional groups and structural characteristics makes this compound a valuable candidate for further research in both synthetic and medicinal chemistry.
Formula:C15H13FO4
InChI:InChI=1/C15H13FO4/c1-8(15(19)20)9-2-4-11(12(16)6-9)10-3-5-13(17)14(18)7-10/h2-8,17-18H,1H3,(H,19,20)
SMILES:CC(c1ccc(c2ccc(c(c2)O)O)c(c1)F)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

