
CAS 66082-27-7
:saframycin A
Description:
Saframycin A is a naturally occurring antibiotic compound that belongs to the class of compounds known as ansamycins. It is produced by certain strains of the bacterium *Micromonospora* and is characterized by its complex structure, which includes a bicyclic core and a unique side chain. Saframycin A exhibits potent antitumor activity, primarily through its ability to intercalate with DNA, thereby inhibiting DNA synthesis and transcription. This mechanism makes it a subject of interest in cancer research. The compound is also known for its ability to induce apoptosis in cancer cells. In terms of solubility, saframycin A is generally soluble in organic solvents but has limited solubility in water, which can affect its bioavailability. Its chemical properties, including stability and reactivity, are influenced by the presence of functional groups within its structure. Overall, saframycin A represents a significant area of study for its potential therapeutic applications in oncology and its unique chemical characteristics.
Formula:C29H30N4O8
InChI:InChI=1/C29H30N4O8/c1-11-23(35)14-8-17-22-21-15(24(36)12(2)28(41-6)26(21)38)7-16(32(22)4)18(9-30)33(17)19(10-31-29(39)13(3)34)20(14)25(37)27(11)40-5/h16-19,22H,7-8,10H2,1-6H3,(H,31,39)
Synonyms:- N-[[(6S)-7α-Cyano-1,5,6,7,9,10,13,14,14aα,15-decahydro-2,11-dimethoxy-3,12,16-trimethyl-1,4,10,13-tetraoxo-6α,15α-epimino-4H-isoquino[3,2-b][3]benzazocin-9β-yl]methyl]-2-oxopropionamide
- Propanamide, N-[[(6S,7R,9R,14aS,15R)-7-cyano-1,5,6,7,9,10,13,14,14a,15-decahydro-2,11-dimethoxy-3,12,16-trimethyl-1,4,10,13-tetraoxo-6,15-imino-4H-isoquino[3,2-b][3]benzazocin-9-yl]methyl]-2-oxo-
- saframycin A
- NSC 325663
- N-{[(6S,7R,9R,14aS,15R)-7-cyano-2,11-dimethoxy-3,12,16-trimethyl-1,4,10,13-tetraoxo-1,5,6,7,9,10,13,14,14a,15-decahydro-4H-6,15-epiminoisoquino[3,2-b][3]benzazocin-9-yl]methyl}-2-oxopropanamide
- N-[(7-cyano-2,11-dimethoxy-3,12,16-trimethyl-1,4,10,13-tetraoxo-1,5,6,7,9,10,13,14,14a,15-decahydro-4H-6,15-epiminoisoquino[3,2-b][3]benzazocin-9-yl)methyl]-2-oxopropanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Saframycin A
CAS:Saframycin A exhibits antibacterial activity against Gram-positive bacteria and shows weaker effects on Gram-negative bacteria and mycobacteria. Additionally, it inhibits mouse lymphocyte L-1210 cells, with an ID50 of 0.0056 μM.Formula:C29H30N4O8Color and Shape:SolidMolecular weight:562.57
