CAS 66082-28-8
:saframycin B
Description:
Saframycin B is a naturally occurring antibiotic compound that belongs to the class of saframycin antibiotics, which are produced by certain strains of the bacterium *Micromonospora*. It is characterized by its complex structure, which includes a bicyclic core and various functional groups that contribute to its biological activity. Saframycin B exhibits potent antitumor properties, making it of interest in cancer research and potential therapeutic applications. The compound operates through mechanisms that may involve DNA intercalation, leading to disruption of cellular processes in rapidly dividing cancer cells. Additionally, it has shown activity against a range of bacterial strains, indicating its potential as an antimicrobial agent. Saframycin B is typically studied in the context of its pharmacological effects, synthesis, and the exploration of its derivatives to enhance efficacy and reduce toxicity. Its CAS number, 66082-28-8, is a unique identifier that facilitates the cataloging and research of this compound in scientific literature and databases.
Formula:C28H31N3O8
InChI:InChI=1/C28H31N3O8/c1-11-22(33)15-7-14-10-31-17(21(30(14)4)20(15)25(36)27(11)39-6)8-16-19(18(31)9-29-28(37)13(3)32)24(35)26(38-5)12(2)23(16)34/h14,17-18,21H,7-10H2,1-6H3,(H,29,37)/t14?,17-,18-,21?/m0/s1
Synonyms:- N-[[(6S)-1,5,6,7,9,10,13,14,14aα,15-Decahydro-2,11-dimethoxy-3,12,16-trimethyl-1,4,10,13-tetraoxo-6α,15α-epimino-4H-isoquino[3,2-b][3]benzazocin-9β-yl]methyl]-2-oxopropionamide
- Propanamide, N-[[(6S,9R,14aS,15R)-1,5,6,7,9,10,13,14,14a,15-decahydro-2,11-dimethoxy-3,12,16-trimethyl-1,4,10,13-tetraoxo-6,15-imino-4H-isoquino[3,2-b][3]benzazocin-9-yl]methyl]-2-oxo-
- saframycin B
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Saframycin B
CAS:<p>Saframycin B exhibits activity against Gram-positive bacteria and has weaker efficacy against mycobacteria.</p>Formula:C28H31N3O8Color and Shape:SolidMolecular weight:537.561
