CAS 660843-22-1

1-[2-[2-(2-Aminoethoxy)ethoxy]ethyl]-1H-pyrrole-2,5-dione

Description:

1-[2-[2-(2-Aminoethoxy)ethoxy]ethyl]-1H-pyrrole-2,5-dione, with the CAS number 660843-22-1, is a synthetic organic compound characterized by its unique pyrrole structure, which includes a dione functional group. This compound features a pyrrole ring substituted with an ethylene glycol derivative that contains an amino group, contributing to its potential solubility in polar solvents. The presence of the aminoethoxy side chain suggests that it may exhibit biological activity, possibly interacting with various biological targets. Its molecular structure indicates potential applications in medicinal chemistry, particularly in drug development, due to the presence of functional groups that can participate in hydrogen bonding and other interactions. Additionally, the compound's stability and reactivity may be influenced by the electronic properties of the pyrrole ring and the substituents attached to it. Overall, this compound represents a class of molecules that could be explored for therapeutic uses, although specific biological activities and properties would require further investigation through experimental studies.

Formula: C₁₀H₁₆N₂O₄

InChI: InChI=1S/C10H16N2O4/c11-3-5-15-7-8-16-6-4-12-9(13)1-2-10(12)14/h1-2H,3-8,11H2

InChI key: InChIKey=SHDYDABQVJGHLD-UHFFFAOYSA-N

SMILES: C(COCCOCCN)N1C(=O)C=CC1=O

Synonyms:

• 1H-Pyrrole-2,5-dione, 1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-
• 1-[2-[2-(2-Aminoethoxy)ethoxy]ethyl]-1H-pyrrole-2,5-dione

Mal-PEG2-NH2

CAS: 660843-22-1

Mal-PEG2-NH2 is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.

Formula: C₁₀H₁₆N₂O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 228.25

Ref: TM-T15981