CAS 660867-80-1
:2-Methylpyridine-4-boronic acid pinacol ester
Description:
2-Methylpyridine-4-boronic acid pinacol ester is an organoboron compound characterized by the presence of a boronic acid functional group and a pyridine ring. This compound typically exhibits a white to off-white solid appearance and is soluble in organic solvents such as dichloromethane and ethanol, while being less soluble in water. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The pinacol ester formation provides stability and enhances the compound's utility in cross-coupling reactions. Additionally, the presence of the methyl group on the pyridine ring can influence the electronic properties and reactivity of the compound. Safety data should be consulted for handling, as boronic acids can be sensitive to moisture and may require specific storage conditions. Overall, 2-Methylpyridine-4-boronic acid pinacol ester is a versatile intermediate in the synthesis of complex organic molecules.
Formula:C12H18BNO2
InChI:InChI=1/C12H18BNO2/c1-9-8-10(6-7-14-9)13-15-11(2,3)12(4,5)16-13/h6-8H,1-5H3
SMILES:Cc1cc(ccn1)B1OC(C)(C)C(C)(C)O1
Synonyms:- 2-Methyl-4-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)Pyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
CAS:Formula:C12H18BNO2Purity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:219.092-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
CAS:Formula:C12H18BNO2Purity:95%Color and Shape:SolidMolecular weight:219.08782-Methylpyridine-4-boronic acid, pinacol ester
CAS:2-Methylpyridine-4-boronic acid, pinacol esterFormula:C12H18BNO2Purity:≥95%Color and Shape: white powderMolecular weight:219.09g/mol2-Methylpyridine-4-boronic acid pinacol ester
CAS:<p>Please enquire for more information about 2-Methylpyridine-4-boronic acid pinacol ester including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C12H18BNO2Purity:Min. 95%Molecular weight:219.09 g/mol2-Methylpyridine-4-boronic acid pinacol ester
CAS:Formula:C12H18BNO2Purity:95%Color and Shape:Solid, No data available.Molecular weight:219.09





