CAS 66091-34-7

1-(3',6'-dihydroxy-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthen]-5-yl)-3-(1,2,3,10-tetramethoxy-9-oxo-5,6,7,9-tetrahydrobenzo[a]heptalen-7-yl)thiourea

Description:

1-(3',6'-Dihydroxy-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthen]-5-yl)-3-(1,2,3,10-tetramethoxy-9-oxo-5,6,7,9-tetrahydrobenzo[a]heptalen-7-yl)thiourea, with CAS number 66091-34-7, is a complex organic compound characterized by its unique structural features, including a thiourea functional group and multiple aromatic rings. This compound exhibits significant molecular complexity due to the presence of spiro and tetrahydrobenzo[a]heptalene moieties, which contribute to its potential biological activity. The presence of hydroxyl and methoxy groups suggests that it may engage in hydrogen bonding and exhibit varied solubility in different solvents. Such structural characteristics often indicate potential applications in fields like medicinal chemistry, where compounds with intricate structures can exhibit interesting pharmacological properties. Additionally, the compound's stability and reactivity may be influenced by its functional groups, making it a subject of interest for further research in organic synthesis and material science. Overall, this compound represents a fascinating example of synthetic organic chemistry with potential implications in various scientific domains.

Formula: C₄₁H₃₄N₂O₁₀S

InChI: InChI=1/C41H34N2O10S/c1-48-32-14-9-24-25(19-31(32)46)30(13-5-20-15-35(49-2)37(50-3)38(51-4)36(20)24)43-40(54)42-21-6-10-27-26(16-21)39(47)53-41(27)28-11-7-22(44)17-33(28)52-34-18-23(45)8-12-29(34)41/h6-12,14-19,30,44-45H,5,13H2,1-4H3,(H2,42,43,54)

SMILES: COc1ccc2c(cc1=O)C(CCc1cc(c(c(c21)OC)OC)OC)NC(=Nc1ccc2c(c1)C(=O)OC12c2ccc(cc2Oc2cc(ccc12)O)O)S

Colchicine fluorescein

CAS: 66091-34-7

Colchicine fluorescein is the fluorogenic form of colchicine. It is used for staining assembly of tubulin. Colchicine-site inhibitors (abbrevated as CBSIs) disrupt tubulin polymerization. Colchicine fluorescein serves as a probe to study the binding of colchicine to tubulin, as the colchicine binding site is a promising target for discovering novel antitumour agents.

Formula: C₄₁H₃₄N₂O₁₀S

Purity: Min. 90 Area-%

Color and Shape: Orange Powder

Molecular weight: 746.78 g/mol

Ref: 3D-EC58703