CAS 66095-81-6

2-[(2-Methoxy-4-nitrophenyl)amino]ethanol

Description:

2-[(2-Methoxy-4-nitrophenyl)amino]ethanol, with the CAS number 66095-81-6, is an organic compound characterized by its amine and alcohol functional groups. This substance features a methoxy group and a nitro group attached to a phenyl ring, which contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the amino group allows for hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the nitro group can influence the compound's electronic properties, making it a candidate for further chemical modifications. The compound's structure suggests it may exhibit biological activity, which could be explored in medicinal chemistry. Its stability and reactivity can be affected by environmental conditions, such as pH and temperature. Safety data should be consulted for handling and storage, as compounds with nitro groups can sometimes pose risks. Overall, 2-[(2-Methoxy-4-nitrophenyl)amino]ethanol is a versatile compound with potential utility in various chemical applications.

Formula: C₉H₁₂N₂O₄

InChI: InChI=1S/C9H12N2O4/c1-15-9-6-7(11(13)14)2-3-8(9)10-4-5-12/h2-3,6,10,12H,4-5H2,1H3

InChI key: InChIKey=DZFVBIGUJAYIFJ-UHFFFAOYSA-N

SMILES: N(CCO)C1=C(OC)C=C(N(=O)=O)C=C1

Synonyms:

• 2-N-(β-Hydroxyethyl)amino-5-nitroanisole
• Ethanol, 2-[(2-methoxy-4-nitrophenyl)amino]-
• 2-[(2-Methoxy-4-nitrophenyl)amino]ethanol

2-[(2-Methoxy-4-nitrophenyl)amino]ethan-1-ol

CAS: 66095-81-6

2-[(2-Methoxy-4-nitrophenyl)amino]ethan-1-ol is a scientific chemical that is used in the production of care products. It is an allergen, as it has been shown to cause allergic reactions in population studies. Care products containing 2-[(2-Methoxy-4-nitrophenyl)amino]ethan-1-ol can cause sensitization, even if they are not directly applied to the skin. This chemical is tested for use in human subjects and for sensitization tests in animals. 2-[(2-Methoxy-4-nitrophenyl)amino]ethan-1-ol can be found in the environment due to its widespread use and accidental spills.

Formula: C₉H₁₂N₂O₄

Purity: Min. 95%

Molecular weight: 212.2 g/mol

Ref: 3D-RCA09581