CAS 6610-24-8
:Sodium palmitoleate
Description:
Sodium palmitoleate, with the CAS number 6610-24-8, is the sodium salt of palmitoleic acid, a monounsaturated fatty acid. It is characterized by its long hydrocarbon chain, which typically contains 16 carbon atoms and one double bond, making it an omega-7 fatty acid. This compound is typically found in the form of a white to off-white powder or solid and is soluble in water due to the presence of the sodium ion. Sodium palmitoleate is known for its emulsifying and surfactant properties, making it useful in various applications, including cosmetics, food products, and pharmaceuticals. Additionally, it has potential health benefits, as palmitoleic acid is associated with anti-inflammatory properties and may play a role in metabolic health. Its stability and reactivity can vary depending on environmental conditions, such as temperature and pH. Overall, sodium palmitoleate is a versatile compound with applications in both industrial and health-related fields.
Formula:C16H30O2·Na
InChI:InChI=1S/C16H30O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;/h7-8H,2-6,9-15H2,1H3,(H,17,18);/b8-7-;
InChI key:InChIKey=VPPNWOWGOVJMQZ-CFYXSCKTSA-N
SMILES:C(CC/C=C\CCCCCC)CCCCC(O)=O.[Na]
Synonyms:- 9-Hexadecenoic acid, sodium salt (1:1), (9Z)-
- 9-Hexadecenoic acid, sodium salt, (9Z)-
- 9-Hexadecenoic acid, sodium salt, (Z)-
- Palmitoleic acid sodium salt
- Sodium palmitoleate
- sodium (9E)-hexadec-9-enoate
- Sodium (Z)-hexadec-9-enoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Palmitoleic Acid sodium
CAS:Palmitoleic acid, an ω-7 monounsaturated fatty acid found in macadamia and sea buckthorn oils, enhances both basal and insulin-stimulated glucose uptake, as well as Glut4 protein levels in 3T3-L1 adipocytes at a 200 µM concentration. Ex vivo, at a dosage of 300 mg/kg per day, it significantly increases glucose uptake and both aerobic and anaerobic glycolysis, while decreasing de novo fatty acid synthesis and the activity of lipogenic enzymes, specifically ATP citrate lyase (ACL) and glucose-6-phosphate dehydrogenase (G6PDH), in isolated murine adipocytes. Furthermore, the dietary administration of palmitoleic acid at 300 mg/kg mitigates high-fat diet-induced insulin resistance and liver inflammation in mice.Formula:C16H29O2NaColor and Shape:SolidMolecular weight:276.39

