CAS 6610-29-3
:Methylthiosemicarbazide
Description:
Methylthiosemicarbazide is an organic compound characterized by its thiosemicarbazide structure, which includes a methyl group and a thiomethyl group. It is typically represented by the formula C4H10N4S and features a thiosemicarbazide functional group, which is known for its ability to form coordination complexes with various metal ions. This compound is often utilized in the synthesis of other chemical entities and has applications in medicinal chemistry, particularly in the development of potential pharmaceuticals. Methylthiosemicarbazide is a white to off-white crystalline solid that is soluble in water and organic solvents. It exhibits properties such as moderate stability under standard conditions, but it may decompose upon exposure to strong acids or bases. Additionally, it can participate in various chemical reactions, including condensation and complexation, making it a versatile building block in organic synthesis. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C2H7N3S
InChI:InChI=1S/C2H7N3S/c1-4-2(6)5-3/h3H2,1H3,(H2,4,5,6)
InChI key:InChIKey=PTVZQOAHCSKAAS-UHFFFAOYSA-N
SMILES:C(NC)(NN)=S
Synonyms:- 1-Amino-3-methylthiourea
- 1-Methylhydrazinecarbothioamide
- 2-(Methylsulfanyl)Hydrazinecarboxamide
- 2-Methylhydrazinecarbothioamide
- 3-Amino-1-methylthiourea
- 4-Methyl-3-thiosemicarbazide
- 4-Methylthiosemicarbazone
- 4-N-Methylthiosemicarbazide
- B 1130
- Hydrazinecarbothioamide, N-methyl-
- Methylthiosemicarbazide
- N-Methyl-hydrazine carbothioamide
- N-Methylthiosemicarbazide
- N-methylhydrazinecarbothioamide
- NSC 56911
- Semicarbazide, 4-methyl-3-thio-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
4-Methylthiosemicarbazide
CAS:Formula:C2H7N3SPurity:>95.0%(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:105.16N-Methylhydrazinecarbothioamide
CAS:Formula:C2H7N3SPurity:96%Color and Shape:SolidMolecular weight:105.16214-Methyl-3-thiosemicarbazide
CAS:Formula:C2H7N3SPurity:95.0%Color and Shape:Solid, Off-white crystallineMolecular weight:105.164-Methyl-3-thiosemicarbazide
CAS:Controlled ProductFormula:C2H7N3SColor and Shape:WhiteMolecular weight:105.163-Amino-1-methylthiourea
CAS:3-Amino-1-methylthiourea is a compound that has been used in biological studies and has shown to have neurotrophic properties. 3-Amino-1-methylthiourea has been studied for its ability to inhibit the growth of skin cancer cells, and it has been shown to be a potent inhibitor of the mitochondrial membrane potential. This compound binds to the sulfhydryl groups on proteins, which prevents their oxidation. It also blocks the release of nitric oxide from cells by reacting with reactive oxygen species (ROS) and reducing them to harmless forms. 3-Amino-1-methylthiourea is an amide with two nitrogen atoms, one of which is located in an asymmetric unit. The other nitrogen atom is bonded to three carbonyl groups and one methyl group, forming a five member ring.Formula:C2H7N3SPurity:Min. 95%Molecular weight:105.16 g/mol







