CAS 6610-56-6
:Glochidiol
Description:
Glochidiol, with the CAS number 6610-56-6, is a naturally occurring chemical compound primarily derived from certain plant sources, particularly within the family of Cactaceae. It is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. Glochidiol exhibits properties such as antimicrobial and anti-inflammatory effects, making it of interest in pharmacological research. The compound is typically found in a solid state at room temperature and is soluble in organic solvents, which facilitates its extraction and purification from plant materials. Its unique structure allows it to interact with various biological targets, potentially leading to therapeutic applications. Additionally, research into glochidiol may explore its role in traditional medicine and its potential benefits in modern healthcare. As with many natural products, the study of glochidiol encompasses aspects of organic chemistry, biochemistry, and pharmacognosy, highlighting its significance in both scientific research and potential medicinal use.
Formula:C30H50O2
InChI:InChI=1S/C30H50O2/c1-18(2)19-11-13-27(5)15-16-28(6)20(25(19)27)9-10-22-29(28,7)14-12-21-26(3,4)23(31)17-24(32)30(21,22)8/h19-25,31-32H,1,9-17H2,2-8H3/t19-,20+,21-,22-,23+,24+,25+,27+,28+,29+,30-/m0/s1
InChI key:InChIKey=SWEUJTWPRYKNNX-DZEONHSJSA-N
SMILES:C[C@]12[C@@]([C@]3(C)[C@@](CC1)(C(C)(C)[C@H](O)C[C@H]3O)[H])(CC[C@]4([C@@]2(C)CC[C@]5(C)[C@@]4([C@H](C(C)=C)CC5)[H])[H])[H]
Synonyms:- Lup-20(29)-ene-1β,3α-diol
- Glochidiol
- Lup-20(29)-ene-1,3-diol, (1β,3α)-
- (1β,3α)-Lup-20(29)-ene-1,3-diol
- Lup-20(30)-ene-1β,3α-diol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Glochidiol
CAS:Glochidiol inhibits human tumor cell lines and mouse skin tumors, induces apoptosis, and blocks EBV-EA and TPA. IC50=290 mol ratio/32 pmol TPA.Formula:C30H50O2Purity:98%Color and Shape:SolidMolecular weight:442.72Glochidiol
CAS:Controlled ProductGlochidiol is a triterpenoid saponin that has potent antitumor activity against skin tumors. It induces apoptosis and inhibits tumor growth in xenograft tumor models. Glochidiol has been shown to inhibit the proliferation of cancer cells by blocking the cell cycle in the G2/M phase, which is associated with an increase in p53 protein levels. Glochidiol also targets multiple apoptosis pathways, including activation of caspases 3, 7, and 9. Glochidiol's anticancer activity is due to its ability to inhibit the activity of tyrosine kinase receptors and inhibit tumor angiogenesis.Purity:Min. 95%



