CAS 6612-70-0

9-[(2R,5R)-5-methyltetrahydrofuran-2-yl]-9H-purin-6-amine

Description:

The chemical substance known as 9-[(2R,5R)-5-methyltetrahydrofuran-2-yl]-9H-purin-6-amine, with the CAS number 6612-70-0, is a purine derivative characterized by its unique structural features. It contains a purine base, which is a fundamental component of nucleic acids, and is substituted with a 5-methyltetrahydrofuran moiety. This substitution can influence its biological activity and solubility. The compound is typically a solid at room temperature and may exhibit moderate to high polarity due to the presence of nitrogen and oxygen atoms in its structure. Its stereochemistry, particularly the (2R,5R) configuration, suggests specific spatial arrangements that can affect its interactions with biological targets, potentially influencing its pharmacological properties. The compound may be of interest in medicinal chemistry and biochemistry, particularly in the context of nucleoside analogs or as a potential therapeutic agent. As with many purine derivatives, it may also participate in various biochemical pathways, making it relevant for research in cellular processes and drug development.

Formula: C₁₀H₁₃N₅O

InChI: InChI=1/C10H13N5O/c1-6-2-3-7(16-6)15-5-14-8-9(11)12-4-13-10(8)15/h4-7H,2-3H2,1H3,(H2,11,12,13)/t6-,7-/m1/s1

SMILES: C[C@@H]1CC[C@H](n2cnc3c(N)ncnc23)O1

Synonyms:

• 9H-purin-6-amine, 9-[(2R,5R)-tetrahydro-5-methyl-2-furanyl]-
• 9-[(2R,5R)-5-Methyltetrahydrofuran-2-yl]-9H-purin-6-amine

9-(Tetrahydro-5-methyl-2-furyl)adenine

CAS: 6612-70-0

9-(Tetrahydro-5-methyl-2-furyl)adenine is a synthetic cytokinin, which is a type of plant growth regulator. This compound is derived from chemical synthesis, rather than extraction from natural sources. The mode of action involves promoting cell division and differentiation in plant tissues, primarily by enhancing the synthesis of proteins crucial for growth and development.

Formula: C₁₀H₁₃N₅O

Purity: Min. 95%

Molecular weight: 219.24 g/mol

Ref: 3D-GAA61270