CAS 66121-71-9

1-methyl-1H-pyrazole-4-carbonitrile

Description:

1-Methyl-1H-pyrazole-4-carbonitrile is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a methyl group at the 1-position and a cyano group at the 4-position contributes to its unique chemical properties. This compound is typically a white to off-white solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its biological activity. It exhibits moderate solubility in polar organic solvents, which can influence its reactivity and interaction with other chemical species. The cyano group is a notable feature, often associated with increased reactivity and the ability to participate in various chemical reactions, including nucleophilic additions. Additionally, the compound's structure allows for potential hydrogen bonding, which can affect its physical properties and interactions in different environments. Overall, 1-methyl-1H-pyrazole-4-carbonitrile is a versatile compound with significant implications in synthetic chemistry and material science.

Formula: C₅H₅N₃

InChI: InChI=1/C5H5N3/c1-8-4-5(2-6)3-7-8/h3-4H,1H3

SMILES: Cn1cc(C#N)cn1

Synonyms:

• 1H-Pyrazole-4-carbonitrile, 1-methyl-
• 1-Methyl-1H-pyrazole-4-carbonitrile
• 1H-Pyrazole-4-carbonitrile,1-methyl-(9CI)
• 1-Methyl-Pyrazole-4-carbonitrile
• 4-Cyano-1-Methylpyrazole
• 1-Methyl-4-cyanopyrazole
• 1-methyl-1H-pyrazole-4-carbonitrile(SALTDATA: FREE)

4-Cyano-1-methylpyrazole

CAS: 66121-71-9

Formula: C₅H₅N₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 107.1133

Ref: IN-DA0039XJ

1-Methyl-1H-pyrazole-4-carbonitrile

CAS: 66121-71-9

1-Methyl-1H-pyrazole-4-carbonitrile

Purity: 97%

Color and Shape: Solid

Molecular weight: 107.11g/mol

Ref: 54-OR939081

1-Methyl-1H-pyrazole-4-carbonitrile

CAS: 66121-71-9

Formula: C₅H₅N₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 107.116

Ref: 10-F037414