CAS 66134-57-4

3-acetyl-1-ethyl-2-hydroxyquinolin-4(1H)-one

Description:

3-Acetyl-1-ethyl-2-hydroxyquinolin-4(1H)-one, with the CAS number 66134-57-4, is a chemical compound that belongs to the class of quinoline derivatives. This substance typically exhibits a yellow to orange crystalline appearance and is characterized by its complex aromatic structure, which includes a quinoline ring system. The presence of an acetyl group and a hydroxy group contributes to its reactivity and potential biological activity. It is soluble in organic solvents and may have limited solubility in water, depending on the pH. The compound is of interest in various fields, including medicinal chemistry, due to its potential pharmacological properties, such as antimicrobial or anti-inflammatory effects. Additionally, its structural features may allow for interactions with biological targets, making it a candidate for further research in drug development. Safety data should be consulted for handling and usage, as with all chemical substances, to ensure proper precautions are taken.

Formula: C₁₃H₁₃NO₃

InChI: InChI=1/C13H13NO3/c1-3-14-10-7-5-4-6-9(10)12(16)11(8(2)15)13(14)17/h4-7,17H,3H2,1-2H3

SMILES: CCn1c2ccccc2c(=O)c(C(=O)C)c1O

3-Acetyl-1-ethyl-4-hydroxy-1,2-dihydroquinolin-2-one

CAS: 66134-57-4

3-Acetyl-1-ethyl-4-hydroxy-1,2-dihydroquinolin-2-one

Purity: 95%

Molecular weight: 231.25g/mol

Ref: 54-OR32147