CAS 66137-74-4
:1,1,2,2-Tetrafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)ethanesulfonyl fluoride
Description:
1,1,2,2-Tetrafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)ethanesulfonyl fluoride, with CAS number 66137-74-4, is a fluorinated organic compound characterized by its complex structure, which includes multiple fluorine atoms and an iodine substituent. This compound is part of a class of sulfonyl fluorides, which are known for their reactivity and utility in various chemical applications, including as intermediates in organic synthesis and in the development of pharmaceuticals. The presence of fluorine atoms enhances the compound's stability and lipophilicity, making it useful in various chemical processes. Additionally, the iodine substituent can facilitate further chemical transformations, such as nucleophilic substitutions. The compound is typically handled with care due to its potential reactivity and the presence of toxic components. Its physical properties, such as boiling point, melting point, and solubility, are influenced by its fluorinated structure, which often leads to low volatility and high thermal stability. Overall, this compound exemplifies the unique characteristics of fluorinated sulfonyl compounds in modern chemistry.
Formula:C4F9IO3S
InChI:InChI=1S/C4F9IO3S/c5-1(6,14)2(7,8)17-3(9,10)4(11,12)18(13,15)16
InChI key:InChIKey=XSLYISNQTJHKMP-UHFFFAOYSA-N
SMILES:C(C(S(F)(=O)=O)(F)F)(OC(C(F)(F)I)(F)F)(F)F
Synonyms:- 1,1,2,2-Tetrafluoro-2-(1,1,2,2-Tetrafluoro-2-Iodoethoxy)Ethanesulfonyl Fluoride
- 2-(2-Iodo-1,1,2,2-tetrafluoroethoxy)-1,1,2,2-tetrafluoroethanesulfonyl fluoride
- 2-(2-Iodotetrafluoroethoxy)tetrafluoroethanesulfonyl fluoride
- 3,3,3-Trifluoroprop-1-Yne
- 5-Iodo-octafluoropentyl-3-oxapentanesulfonyl fluoride
- 5-Iodooctafluoro-3-Oxapentanesulfonyl Fluoride
- 5-Iodooctafluoro-3-oxapentanesulphonyl fluoride
- Ethanesulfonyl fluoride, 1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)-
- Tetrafluoro-2-(tetrafluoro-2-iodoethoxy)ethanesulfonyl fluoride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Tetrafluoro-2-(tetrafluoro-2-iodoethoxy)ethanesulfonyl Fluoride (stabilized with Na2S2O3)
CAS:Formula:C4F9IO3SPurity:>95.0%(GC)Color and Shape:Colorless to Light yellow to Red clear liquidMolecular weight:425.991,1,2,2-Tetrafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)ethanesulfonyl fluoride
CAS:Formula:C4F9IO3SPurity:95%Color and Shape:LiquidMolecular weight:425.9961Perfluoro-5-iodo-3-oxapentanesulphonyl fluoride
CAS:<p>Perfluoro-5-iodo-3-oxapentanesulphonyl fluoride</p>Formula:C4F9IO3SPurity:95%Color and Shape: clear liquidMolecular weight:426.00g/molTetrafluoro-2-(tetrafluoro-2-iodoethoxy)ethanesulfonyl fluoride
CAS:<p>Tetrafluoro-2-(tetrafluoro-2-iodoethoxy)ethanesulfonyl fluoride (TFEI) is a fluorinated solvent that has been used in the manufacture of organic thin films. TFEI is a colorless liquid with a strong, unpleasant odor. It is soluble in water and has a boiling point of about 140°C. TFEI possesses good thermal stability and can be used as an etchant for silicon or glass surfaces. TFEI is also capable of dissolving polymers such as polyimide, polyamide, polyethylene terephthalate, and polystyrene.<br>TFEI has been shown to be highly toxic to bacteria and fungi and can be used as an antimicrobial agent in household cleaners, paints, adhesives, varnishes, plastics, textiles, and other industrial products.</p>Formula:C4F9IO3SPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:426 g/mol1,1,2,2-Tetrafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)ethanesulfonyl fluoride
CAS:Purity:96%Molecular weight:425.9899902
