CAS 661470-61-7

3-(4-methyl-1,2,4-triazol-3-yl)piperidine

Description:

3-(4-methyl-1,2,4-triazol-3-yl)piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring and a triazole moiety. The piperidine portion contributes to its cyclic amine properties, making it a potential candidate for various biological activities. The presence of the 4-methyl-1,2,4-triazole group introduces heteroatoms, which can enhance its interaction with biological targets, potentially influencing its pharmacological properties. This compound is often studied in medicinal chemistry for its potential applications in drug development, particularly in the fields of antifungal and antimicrobial agents. Its solubility, stability, and reactivity can vary based on the functional groups present and the overall molecular structure. Additionally, the compound's CAS number, 661470-61-7, allows for easy identification and retrieval of information in chemical databases. Overall, 3-(4-methyl-1,2,4-triazol-3-yl)piperidine exemplifies the complexity and diversity of organic compounds used in research and industry.

Formula: C₈H₁₄N₄

InChI: InChI=1/C8H14N4/c1-12-6-10-11-8(12)7-3-2-4-9-5-7/h6-7,9H,2-5H2,1H3

SMILES: Cn1cnnc1C1CCCNC1

Synonyms:

• 3-(4-methyl-4H-1,2,4-triazol-3-yl)piperidine
• piperidine, 3-(4-methyl-4H-1,2,4-triazol-3-yl)-

3-(4-Methyl-4H-1,2,4-triazol-3-yl)piperidine

CAS: 661470-61-7

Versatile small molecule scaffold

Formula: C₈H₁₄N₄

Purity: Min. 95%

Molecular weight: 166.22 g/mol

Ref: 3D-LBB47061